Chuyên đề Hóa học 11 - Chương I - Sự điện li

doc 52 trang mainguyen 26/02/2021 4490
Bạn đang xem 20 trang mẫu của tài liệu "Chuyên đề Hóa học 11 - Chương I - Sự điện li", để tải tài liệu gốc về máy bạn click vào nút DOWNLOAD ở trên

Tài liệu đính kèm:

  • docchuyen_de_hoa_hoc_11_chuong_i_su_dien_li.doc

Nội dung text: Chuyên đề Hóa học 11 - Chương I - Sự điện li

  1. to Thí dụ : 2KNO3  2KNO2 + O2 - Muối nitrat của kẽm, sắt, chì, đồng, bị phân huỷ thành oxit kim loại tương ứng, NO2 và O2: to Thí dụ : 2Cu(NO3)2  2CuO + 4NO2 + O2 - Muối nitrat của bạc, vàng, thuỷ ngân, bị phân huỷ thành kim loại tương ứng, khí NO2 và O2. to Thí dụ : 2AgNO3  2Ag + 2NO2 + O2 3. Nhận biết ion nitrat - Để nhận ra ion NO3 , người ta đun nóng nhẹ dung dịch chứa NO3 với Cu và H2SO4 loãng: + 2+ 3Cu + 8H + 2NO3 3Cu + 2NO + 4H2O (xanh) (không màu) 2NO + O2 NO2 (nâu đỏ) Phản ứng tạo dung dịch màu xanh và khí màu nâu đỏ thoát ra. V. PHOTPHO 1. Vị trí - Cấu hình electron nguyên tử a. Vị trí: Ô thứ 15, nhóm VA, chu kỳ 3 trong bảng tuần hoàn. b. Cấu hình electron: 1s22s22p63s23p3. 2. Tính chất vật lý - Photpho có hai dạng thù hình: Photpho trắng và photpho đỏ. Tùy vào điều kiện mà P(t) có thể chuyển thành P (đ) và ngược lại. - P (t) kém bền hơn photpho đỏ. Do vậy để bảo quản P (t) người ta ngâm vào nước. 3. Tính chất hóa học - Trong các hợp chất, photpho có các số oxi hóa -3, +3, +5. - Trong các phản ứng hóa học photpho thể hiện tính oxi hóa hoặc tính khử. a. Tính oxi hóa 0 -3 t0 2 P + 3Ca  Ca3 P2 (canxi photphua) b. Tính khử * Tác dụng với oxi 0 +3 t0 - Thiếu oxi: 4P + 3O2  2P2 O3 0 +5 t0 - Dư oxi: 4 P+ 5O2  2 P2 O5 * Tác dụng với Clo 0 +3 t0 - Thiếu clo: 2 P+ 3Cl2  2 P Cl3 0 +5 t0 - Dư clo: 2 P+ 5Cl2  2 P Cl5 4. Trạng thái tự nhiên - Trong tự nhiên photpho không tồn tại dưới dạng tự do. Hai khoáng vật quan trọng của photpho là: photphorit Ca3(PO4)2 và apatit 3Ca3(PO4)2.CaF2. VI. AXIT PHOTPHORIC - MUỐI PHOTPHAT 1. Axit photphoric a. Tính chất hóa học - Là một axit ba nấc, có độ mạnh trung bình. Có đầy đủ tính chất hóa học của một axit.  + - H3PO4  H + H2PO4 -  + 2- H2PO4  H + HPO4 2-  + 3- HPO4  H + PO4 Tài liệu ôn tập Hóa Học 11 9
  2. - Khi tác dụng với dung dịch kiềm, tùy theo lượng chất mà tạo ra các muối khác nhau. H3PO4 + NaOH → NaH2PO4 + H2O H3PO4 + 2NaOH → Na2HPO4 + 2H2O H3PO4 + 3NaOH → Na3PO4 + 3H2O b. Điều chế * Trong phòng thí nghiệm P + 5HNO3 → H3PO4 + 5NO2 + H2O * Trong công nghiệp - Cho axit sunfuric đặc tác dụng với quặng apatit hoặc photphoric t0 Ca3(PO4)2 + 3H2SO4 (đặc)  2H3PO4 + 3CaSO4↓ - Để sản xuất axit photphoric với độ tinh khiết và nồng độ cao hơn người ta điều chế từ P t0 4P + 5O2  2P2O5 P2O5 + 3H2O  2H3PO4 2. Muối photphat a. Định nghĩa - Muối photphat là muối của axit photphoric. - Muối photphat được chia thành 3 loại Muối đihiđrophotphat : NaH2PO4, NH4H2PO4, Ca(H2PO4)2 Muối hiđrophotphat : Na2HPO4, (NH4)2HPO4, CaHPO4 Muối photphat : Na3PO4, (NH4)3PO4, Ca3(PO4)2 b. Nhận biết ion photphat - Thuốc thử: dung dịch AgNO3 - Hiện tượng: Xuất hiện kết tủa màu vàng + 3- 3Ag + PO4 Ag3PO4  (màu vàng) VII. PHÂN BÓN HÓA HỌC - Phân bón hóa học là những hóa chất có chứa các nguyên tố dinh dưỡng, được bón cho cây nhằm nâng cao năng suất mùa màng. 1. Phân đạm - Phân đạm cung cấp nitơ hóa hợp cho cây dưới dạng ion nitrat NO3 và ion amoni NH4 . - Độ dinh dưỡng của phân đạm được đánh giá theo tỉ lệ % về khối lượng nguyên tố nitơ. a. Phân đạm amoni - Đó là các muối amoni: NH4Cl, NH4NO3, (NH4)2SO4 - Được điều chế bằng cách cho NH3 tác dụng với axit tương ứng. 2NH3 + H2SO4 → (NH4)2SO4 b. Phân đạm nitrat - Đó là các muối nitrat: NaNO3, Ca(NO3)2 - Được điều chế bằng phản ứng giữa axit HNO3 và muối cacbonat tương ứng. CaCO3 + 2HNO3 → Ca(NO3)2 + CO2↑ + 2H2O c. Phân đạm urê - (NH2)2CO (chứa khoảng 46%N) là loại phân đạm tốt nhất hiện nay. - Được điều chế bằng cách cho NH3 tác dụng với CO ở nhiệt độ và áp suất cao. t0 , p 2NH3 + CO  (NH2)2CO + H2O - Trong đất urê dần chuyển thành muối cacbonat (NH2)2CO + 2H2O → (NH4)2CO3. 2. Phân lân 3- - Phân lân cung cấp nguyên tố P cho cây dưới dạng ion photphat (PO4 ). Tài liệu ôn tập Hóa Học 11 10
  3. - Độ dinh dưỡng của phân lân được đánh giá theo tỉ lệ % khối lượng P2O5 tương ứng với lượng P có trong thành phần của nó. a. Supephotphat - Có hai loại: supephotphat đơn và supephotphat kép. * Supephotphat đơn: Gồm hai muối: Ca(H 2PO4)2 và CaSO4. Được điều chế bằng cách cho quặng photphorit hoặc apatit tác dụng với axit H2SO4 đặc. Ca3(PO4)2 + 2H2SO4 (đặc) → Ca(H2PO4)2 + CaSO4↓ * Supephotphat kép: Đó là muối Ca(H2PO4)2. Được điều chế qua hai giai đoạn Ca3(PO4)2 + 3H2SO4 → 2H3PO4 + 3CaSO4↓ Ca3(PO4)2 + H3PO4 → 3Ca(H2PO4)2 3. Phân kali - Phân kali cung cấp nguyên tố K dưới dạng ion K+. - Độ dinh dưỡng của phân K được đánh gái theo tỉ lệ % khối lượng K 2O tương ứng với lượng K có trong thành phần của nó. 4. Phân hỗn hợp - Phân phức hợp a. Phân hỗn hợp: chứa N, P, K được gọi chung là phân NPK. - Thí dụ: (NH4)2HPO4 và KNO3. b. Phân phức hợp: Thí dụ: Phân amophot là hỗn hợp các muối NH4H2PO4 và (NH4)2HPO4. 5. Phân vi lượng: - Phân vi lượng cung cấp cho cây các nguyên tố như bo, kẽm, mangan, đồng ở dạng hợp chất. B. BÀI TẬP CÓ HƯỚNG DẪN GIẢI I. Bài tập về axit HNO3 * Khi giải bài tập về axit HNO 3 ta chủ yếu dựa vào phương pháp bảo toàn số mol electron để giải bài tập. Nội dung chủ yếu của phương pháp này là - sè mol electron nh­êng = sè mol electron nhËn . - Xác định đúng trạng thái số oxi hóa đầu và cuối. * Các hệ quả chủ yếu khi sử dụng phương pháp bảo toàn số mol electron: - Khối lượng muối nitrat thu được (không có muối NH4NO3) là m = m + m ; m = 62* sè mol electron nh­êng hoÆc nhËn . Muèi kim lo¹i NO- NO-  3 3 - Số mol HNO3 cần dung để hòa tan hết hỗn hợp các kim loại n = 4n + 2n + 12n + 10n + 10n HNO3 NO NO2 N2 N2O NH4NO3 Câu 1. Hòa tan hoàn toàn m gam Al bằng 500 ml dung dịch HNO3 CM (vừa đủ) thu được 0.01 mol NO, 0.03 mol NO2 và dung dịch A chứa x gam muối (không có muối NH4NO3). a. Tính giá trị m. b. Tính CM (HNO3) đã dung ban đầu. c. Tính giá trị x. Giải * Cách 1: Đây là cách mà chúng ta thường dùng khi giải các bài tập hóa học thông thường Al + 4HNO3 → Al(NO3)3 + NO↑ + 2H2O 0.01← 0.04← 0.01← 0.01 Al + 6HNO3 → Al(NO3)3 + 3NO2↑ + 3H2O 0.01← 0.06 0.01← 0.03 a. mAl = 0.02*27 = 0.54 (gam). n 0.1 b. C = HNO3 = = 0.2 (M) M(HNO3 ) V 0.5 Tài liệu ôn tập Hóa Học 11 11
  4. c. m = 0.02*213 = 4.26 (gam) Al(NO3 )3 * Cách 2: Ta dựa vào phương pháp bảo toàn số mol electron và các hệ quả của nó để giải bài tập 4 N 5 + 1e N O 2 Al Al3 + 3e 0.03 0.03 2 0.02 0.06 N 5 + 3e N O 0.03 0.01 a. mAl = 0.02*27 = 0.54 (gam) n 0.1 b. n = 4*0.01 + 2*0.03 = 0.1 (mol) C = HNO3 = = 0.2 (M) HNO3 M(HNO3 ) V 0.5 c. mAl(NO ) = mAl + m = 0.54 + 62*0.06 = 4.26 (gam) 3 3 NO3 Câu 2. Khi cho 9.1 gam hỗn hợp Cu và Al tác dụng với dung dịch HNO 3 đặc, dư đun nóng sinh ra 11.2 lít khí NO2 (đktc) là sản phẩm khử duy nhất. a. Tính % khối lượng mỗi kim loại trong hỗn hợp ban đầu. b. Tính khối lượng muối thu được. Giải Bài này ta có thể giải theo nhiều cách khác nhau. Tuy nhiên ở đây trong phạm vi chương này ta có thể áp dụng phương pháp bảo toàn số mol electron để giải bài tập này. V 11.2 * n = = = 0.5 (mol) NO2 22.4 22.4 Đặt nCu = x; nAl = y. Cu0 Cu2 + 2e 4 x 2x 5 ; N + 1e N O2 0 3 Al Al + 3e 0.5 0.5 y 3y Từ đó ta có hệ PT như sau 2x + 3y = 0.5 x = 0.1 64x + 27y = 9.1 y = 0.1 m 0.1*27 a. %Al = Al *100 = *100 = 29.67% ; %Cu = 100 - %Al = 100 - 29.67 = 70.33%. mhh 9.1 b. mMuèi = mkim lo¹i + m - = 9.1 + 62*0.5 = 40.1 (gam) NO3 II. Bài tập về P2O5, H3PO4 tác dụng với dung dịch kiềm H3PO4 + NaOH→ NaH 2PO4 + H2O H3PO4 + 2NaOH→ Na 2HPO4 + 2H2O H3PO4 + 3NaOH→ Na 3PO4 + 3H2O n OH Đặt T = . Nếu T ≤ 1 → tạo muối duy nhất NaH 2PO4 n H3PO4 1 < T < 2 → tạo hỗn hợp hai muối NaH 2PO4 và Na2HPO4 T = 2→ tạo muối duy nhất Na 2HPO4 2 < T < 3→ tạo hỗn hợp hai muối Na 2HPO4 và Na3PO4 T ≥ 3→ tạo muối duy nhất Na 3PO4. Chú ý: Tài liệu ôn tập Hóa Học 11 12
  5. - Khi giải toán dạng này thì đầu tiên ta phải xác định xem muối nào được tạo thành bằng các tính giá trị T. Nếu trường hợp tạo hai muối thì thường ta sẽ lập hệ PT để giải BT. - Nếu đề ra không cho H3PO4 mà cho P2O5 thì ta giải hoàn toàn tương tự nhưng mà n = 2n H3PO4 P2O5 Ví dụ: Trộn 100 ml dung dịch NaOH 1.5M với 100 ml dung dịch H3PO4 1M thu được dung dịch A. Tính khối lượng các chất tan trong A. Giải * nNaOH = 1.5*0.1 = 0.15 (mol); n = 0.1*1 = 0.1 (mol) H3PO4 n OH 0.15 * T = = = 1.5 → tạo hỗn hợp hai muối NaH 2PO4 và Na2HPO4. Đặt số mol mỗi muối lần n 0.1 H3PO4 lượt là x và y. H3PO4 + NaOH→ NaH 2PO4 + H2O x x x H3PO4 + 2NaOH→ Na 2HPO4 + 2H2O y 2y y m = 0.05*120 = 6 (gam) x + y = 0.1 x = 0.05 NaH2PO4 Ta có hệ PT: x + 2y = 0.15 y = 0.05 m = 0.05*142 = 7.1 (gam) Na2HPO4 C. PHẦN BÀI TẬP CƠ BẢN Câu 1. Nhận biết dung dịch các chất sau bằng phương pháp hóa học. a. NH3, Na2SO4, NH4Cl, (NH4)2SO4. b. NH4NO3, NaNO3, FeCl3, Na2SO4. c. NH4NO3, NaCl, FeCl3, (NH4)2SO4. d. NH4NO3, NH4Cl, (NH4)2SO4, (NH4)2CO3. Câu 2. Cân bằng các phản ứng sau theo phương pháp thăng bằng electron. a. Al + HNO3 → ? + N 2O + ? b. FeO + HNO3 → ? + NO + ? c. Fe(OH)2 + HNO3 → ? + NO + ? d. Fe3O4 + HNO3 → ? + NO 2 + ? e. Cu + HNO3 → ? + NO 2 + ? f. Mg + HNO3 → ? + N 2 + ? * g . Al + HNO3 → ? + NH 4NO3 + ? * h . R + HNO3 → ? + N 2O + ? * i . FexOy + HNO3 → ? + NO + ? * k . Fe3O4 + HNO3 → ? + N xOy + ? Câu 3. Hoàn thành các chuổi phản ứng sau. 0 +H2O +HCl +NaOH +HNO3 t a. Khí A (1)  dung dịch A (2)  B (3) Khí A (4) C (5) D + H2O (1) (2) (3) (4) (5) (6) b. NO2  HNO3  Cu(NO3)2  Cu(OH)2  Cu(NO3)2  CuO  Cu (2) c. N (1) NH  NH NO 2 3 (3) 4 3 (4) (8) (6) NO (5) NO  HNO 2 (7) 3 Câu 4. Cần lấy bao nhiêu lít khí N 2 và H2 để điều chế được 67,2 lít khí NH 3 (đktc). Biết hiệu suất của phản ứng là 25%. Câu 5. Cho dung dịch NaOH dư vào dung dịch (NH4)2SO4 1M, đun nóng nhẹ. Tài liệu ôn tập Hóa Học 11 13
  6. a. Viết phương trình phân tử, phương trình ion thu gọn. b. Tính thể tích khí thu được ở điều kiện tiêu chuẩn. Câu 6. Hòa tan 3 gam hỗn hợp Cu và CuO trong 1,5 lít dung dịch axit HNO3 1M (loãng) thấy thoát ra 6,72 lít NO (đktc) là sản phẩm khử duy nhất. a. Tính % khối lượng mỗi chất trong hỗn hợp ban đầu. b. Tính nồng độ mol của đồng (II) nitrat và dung dịch axit nitric sau phản ứng. Biết thể tích dung dịch sau phản ứng không thay đổi. Câu 7. Để điều chế 5 tấn axit nitric nồng độ 60% cần dùng bao nhiêu tấn NH 3. Biết sự hao hụt NH3 trong quá trình sản xuất là 3,8%. Câu 8. Đốt cháy hoàn toàn 6,2 gam P trong oxi dư. Cho sản phẩm tạo thành tác dụng vừa đủ với dung dịch NaOH 32% tạo ra muối Na2HPO4. a. Tính khối lượng dung dịch NaOH đã dùng. b. Tính nồng độ % của muối trong dung dịch thu được sau phản ứng. Câu 9. Để thu được muối trung hòa, cần lấy bao nhiêu ml dung dịch NaOH 1M cho tác dụng với 50 ml dung dịch H3PO4 0,5M. Câu 10. Hòa tan hoàn toàn 3.2 gam Cu vào dung dịch HNO3 0.5M (vừa đủ) thu được V lít khí NO (ở đktc, là sản phẩm khử duy nhất). a. Tính giá trị V. b. Tính thể tích dung dịch HNO3 0.5M cần dùng. Câu 11. Hòa tan m gam Al bằng dung dịch HNO3 dư thu được 6.72 lit khí N2 (ở đktc, là sản phẩm khử duy nhất) và dung dịch chứa x gam muối. Tính m và x. Câu 12. Hòa tan m gam Cu bằng dung dịch HNO 3 0.5M (vừa đủ) thu được 0.03 mol NO và 0.02 mol NO2 và dung dịch chứa x gam muối. a. Tính m và x. b. Tính thể tích dung dịch HNO3 0.5M cần dùng. Câu 13. Hòa tan 12 gam hỗn hợp Cu và Fe bằng dung dịch HNO 3 đặc nguội, dư thu được 4,48 lít khí NO2 (ở đktc, là sản phẩm khử duy nhất). Tính % khối lượng mỗi kim loại trong hỗn hợp đầu. Câu 14. Hòa tan 8,3 gam hỗn hợp Al và Fe bằng dung dịch HNO 3 dư thu được 8,96 lít khí NO 2 (đktc, là sản phẩm khử duy nhất) và dung dịch chứa m gam muối. a. Tính khối lượng mỗi kim loại trong hỗn hợp đầu. b. Tính m. Câu 15. Cho 60 gam hỗn hợp Cu và CuO bằng dung dịch HNO 3 dư thu được 6,72 lít khí NO (đktc, là sản phẩm khử duy nhất). Tính % khối lượng mỗi chất trong hỗn hợp đầu. Câu 16. Cho m gam hỗn hợp Fe và Al tan hết trong dung dịch HNO 3 thu được 6,72 lít khí NO (đktc, là sản phẩm khử duy nhất) và dung dịch A. Cô cạn dung dịch A thu được 67,7 gam hỗn hợp các muối khan. Tính khối lượng mỗi kim loại trong hỗn hợp đầu. Câu 17. Cho 68,7 gam hỗn hợp kim loại Al, Fe và Cu tác dụng với dung dịch HNO 3 đặc, nguội, dư. Sau phản ứng thu được 26,88 lít khí NO 2 (đktc, là sản phẩm khử duy nhất) và m gam chất rắn B không tan. Tính m. Câu 10. Khi cho 9.1 gam hỗn hợp Cu và Al tác dụng với dung dịch HNO 3 đặc, dư đun nóng sinh ra 11.2 lít khí NO2 (đktc) là sản phẩm khử duy nhất. Tính % khối lượng mỗi kim loại trong hỗn hợp ban đầu. Câu 11. Cho 19,5 gam một kim loại M hóa trị n tan hết trong dung dịch HNO 3 thu được 4,48 lít khí NO (ở đktc) là sản phẩm khử duy nhất. Xác định kim loại M. Câu 13. Chia hỗn hợp 2 kim loại Cu và Al thành hai phần bằng nhau: Phần 1: Cho tác dụng hoàn toàn với dd HNO 3 đặc, nguội thu được 8,96 lít khí NO 2 (giả sử chỉ tạo ra khí NO2). Tài liệu ôn tập Hóa Học 11 14
  7. Phần 2: Cho tác dụng hoàn toàn với dd HCl thu được 6,72 lít khí. a. Viết các pthh. b. Xác định % về khối lượng của mỗi kim loại trong hỗn hợp trên. Các thể tích khí được đo ở đkc. Câu 14. Hòa tan hoàn toàn 24,8g hỗn hợp kim loại gồm đồng và sắt trong dung dịch HNO 3 0,5M thu được 6,72l (đkc) một chất khí duy nhất, không màu hoá nâu ngoài không khí. a. Tính thành phần phần trăm theo khối lượng mỗi chất trong hỗn hợp ban đầu. b. Tính thể tích dung dịch HNO3 0,5 M cần dùng để hoà tan hết hỗn hợp trên. c. Nếu cho 1/2 lượng hỗn hợp trên vào dung dịch HNO 3 đặc, nguội thì thể tích khí màu nâu đỏ thu được (ở đkc) là bao nhiêu? Câu 15. Cho 21,8g hỗn hợp kim loại gồm bạc và sắt tác dụng vừa đủ với 1,2 lít dung dịch HNO 3 0,5M thu được một chất khí (X) duy nhất, không màu hoá nâu ngoài không khí. a. Tính thành phần phần trăm theo khối lượng mỗi chất trong hỗn hợp ban đầu. b. Tính thể tích khí (X) thu được ở đkc. Câu 16. Chia hỗn hợp Cu và Al làm hai phần bằng nhau: Phần 1: Cho vào dung dịch HNO3 đặc, nguội thì có 8,96 lít khí màu nâu đỏ bay ra. Phần 2: Cho vào dung dịch HCl thì có 6,72 lít khí H2 bay ra. Xác định thành phần % về khối lượng mỗi kim loại trong hỗn hợp ban đầu. Các thể tích khí được đo ở đkc. Câu 17. Cho 11,0 gam hỗn hợp Al và Fe vào dung dịch HNO 3 loãng, dư thì có 6,72 lít khí NO bay ra (đkc) là sản phẩm khử duy nhất. Tính khối lượng mỗi kim loại trong hỗn hợp đầu. Câu 18. Cho hỗn hợp gồm Fe và Zn tác dụng với dung dịch HNO3 đặc nguội thu được 0,896 lít màu nâu ở đkc. Mặt khác, nếu cho hỗn hợp trên tác dụng với dung dịch HCl 10% thu được 0,672 lít khí ở đkc. a. Tính % khối lượng mỗi kim loại trong hỗn hợp. b. Tính khối lượng dung dịch HCl cần dùng. Câu 19. Hòa tan hết 1,92 gam một kim loại trong 1,5 lít dd HNO3 0,15M thu được 0,448 lít khí NO (ở đktc) và dd A. Biết khi phản ứng thể tích dd không thay đổi. a. Xác định kim loại R. b. Tính nồng độ mol của các chất trong dd A. Câu 20. Chia 34,8 gam hỗn hợp kim loại gồm Al, Fe và Cu thành 2 phần bằng nhau: - Phần I: Cho vào dung dịch HNO3 đặc nguội, dư thu được 4,48 lít khí NO2 (ở đktc). - Phần II: Cho vào dung dịch HCl dư thu được 8,96 lít H2 (ở đktc). Hãy xác định khối lượng của Al và Fe trong hỗn hợp ban đầu. Câu 21. Cho 100 ml dung dịch X chứa Al(NO 3)3 0,2M, Cu(NO3)2 0,1M và AgNO3 0,2M tác dụng với dung dịch NH3 dư thu được m gam kết tủa. Xác định giá trị của m. Câu 22. Hoà tan hoàn toàn 0,9 gam kim loại M bằng dung dịch HNO 3 thu được 0,28 lít khí N2O (đktc). Xác định kim loại M. Câu 23. Cho m gam Al tan hoàn toàn trong dung dịch HNO3 thu được 44,8 lít hỗn hợp 3 khí gồm NO, N O và N (ở đktc) có tỉ lệ mol mol: n : n : n = 1: 2 :3 . Xác định giá trị m. 2 2 NO N2 N2O Câu 24. Cho 6,4 g kim loại hóa trị II tác dụng với dd HNO 3 đặc, dư thu được 4,48 lít NO 2 (đkc, là sản phẩm khử duy nhất). Xác định kim loại đó. Câu 25. Cho 15 g hh Cu và Al tác dụng với dd HNO3 loãng (lấy dư) thu được 6,72 lít NO (đktc, là sản phẩm khử duy nhất). Xác định khối lượng của Cu và Al trong hỗn hợp đầu. Câu 26. Hòa tan một lượng 8,32 gam Cu tác dụng vừa đủ với 240 ml dd HNO 3 cho 4,928 lít (ở đktc) hỗn hợp khí gồm NO và NO2 thoát ra. a. Tính số mol của mối khí trong hỗn hợp khí thu được. b. Tính nồng độ dung dịch HNO3 đã dùng. Tài liệu ôn tập Hóa Học 11 15
  8. Câu 27. Cho dung dịch chứa 11,76 gam H 3PO4 vào dung dịch chứa 16,8 gam KOH thu được dung dịch A. Cô cạn dung dịch A thu được m gam muối. Tính giá trị m. Câu 28 (B-09). Cho 100 ml dung dịch KOH 1,5M vào 200 ml dung dịch H3PO4 0,5M, thu được dung dịch X. Cô cạn dung dịch X, thu được m gam hỗn hợp gồm các chất. Xác định các chất đó và khối lượng chúng bằng bao nhiêu? Câu 29 (B-09). Cho 100 ml dung dịch KOH 1,5M vào 200 ml dung dịch H3PO4 0,5M, thu được dung dịch X. Cô cạn dung dịch X, thu được m gam hỗn hợp gồm các chất. Xác định các chất đó và khối lượng chúng bằng bao nhiêu? Câu 30 (B-08). Cho 0,1 mol P2O5 vào dung dịch chứa 0,35 mol KOH. Dung dịch thu được có các chất nào? Khối lượng bằng bao nhiêu? Câu 31. Cho 14,2 gam P2O5 và 100 ml dung dịch chứa NaOH 1M và KOH 2M thu được dung dịch X. Xác định các anion có mặt trong dung dịch X. Câu 32. Thêm 250 ml dung dịch NaOH 2M vào 200ml dung dịch H3PO4 1,5M. a. Tìm khối lượng muối thu được? b. Tính nồng độ mol/l của các chất trong dung dịch tạo thành? PHẦN BÀI TẬP NÂNG CAO Câu 1 (A-2010). Hỗn hợp khí X gồm N2 và H2 có tỉ khối so với He bằng 1,8. Đun nóng X một thời gian trong bình kín (có bột Fe làm xúc tác), thu được hỗn hợp khí Y có tỉ khối so với He bằng 2. Tính hiệu suất của phản ứng tổng hợp NH3. Câu 2. Một lượng 8,32 gam Cu tác dụng vừa đủ với 140 ml dung dịch HNO 3 cho 4,928 lít ở đkc hỗn hợp gồm hai khí NO và NO2 bay ra. a. Tính số mol mỗi khí đã tạo ra. b. Tính nồng độ mol của dung dịch axit ban đầu. Câu 3. Hoà tan Fe trong HNO3 dư thấy sinh ra hỗn hợp khí chứa 0,03 mol NO 2 và 0,02 mol NO. Khối lượng sắt bị hoà tan là bao nhiêu gam? Câu 4. Hòa tan hoàn toàn hỗn hợp gồm 0,1 mol Fe và 0,2 mol Al vào dung dịch HNO3 dư thu được hỗn hợp khí X gồm NO và NO 2 có tỉ lệ mol tương ứng là 2:1. Tính thể tích của hỗn hợp khí X (đktc). Câu 5. Hòa tan hoàn toàn 11 gam hh gồm Fe và Al trong dd HNO3 dư thu được 11,2 lít hh khí X (đktc) gồm NO và NO2 có khối lượng 19,8 gam. Biết phản ứng không tạo NH4NH3. a. Tính thể tích của mỗi khí trong hh X. b. Tính khối lượng của mỗi kim loại trong hỗn hợp đầu. Câu 6. Hoà tan hoàn toàn 5,94g kim loại R trong dung dịch HNO 3 loãng thu được 2,688lít (đktc) hỗn hợp khí gồm NO và N2O có tỷ khối so với H2 là 18,5. Xác định kim loại R. Câu 7. Nung nóng 39 gam hh muối gồm và KNO3 và Cu(NO3)2 đến khối lượng không đổi thu được rắn A và 7,84 lít hỗn hợp khí X (ở đktc). Tính % khối lượng của mỗi muối trong hh ban đầu. Câu 8 (A-09). Nung 6,58 gam Cu(NO3)2 trong bình kín không chứa không khí, sau một thời gian thu được 4,96 gam chất rắn và hỗn hợp khí X. Hấp thụ hoàn toàn X vào nước để được 300 ml dung dịch Y. Tính pH của dung dịch Y. Câu 9. Nung m gam Fe trong không khí, thu được 104,8g hỗn hợp A gồm Fe, FeO, Fe 2O3, Fe3O4. Hoà tan hoàn toàn A trong dung dịch HNO3dư, thu được dung dịch B và 12,096 lít hỗn hợp khí C gồm NO và NO2 (đktc) có tỉ khối so với He là 10,167. Tính giá trị của m. Câu 10. Đốt cháy 5,6g bột Fe nung đỏ trong bình O 2 thu được 7,36 gam hỗn hợp A gồm Fe 2O3, Fe3O4, FeO và Fe. Hoà tan hoàn toàn hỗn hợp A bằng dung dịch HNO 3 thu được V lít hỗn hợp khí B (đktc) gồm NO2 và NO có tỉ khối so với H2 là 19. Xác định giá trị của V. Câu 11. Thuỷ phân hoàn toàn 8,25 gam một photpho trihalogenua thu được dung dịch X. Để trung hoà X cần 100ml dung dịch NaOH 3M. Xác định công thức của photpho trihalogenua. Tài liệu ôn tập Hóa Học 11 16
  9. Câu 12. Cho 150 ml dung dịch KOH 1M tác dụng với 200 ml dung dịch H 3PO4 0,5M. Cô cạn dung dịch sau phản ứng thu được m gam muối. Tính m. Câu 13 (B-08). Tính thể tích dung dịch HNO3 1M (loãng) ít nhất cần dùng để hoà tan hoàn toàn một hỗn hợp gồm 0,15 mol Fe và 0,15 mol Cu là bao nhiêu (biết phản ứng tạo chất khử duy nhất là NO)? Câu 14 (A-09). Cho 3,024 gam một kim loại M tan hết trong dung dịch HNO3 loãng, thu được 940,8 ml khí NxOy (sản phẩm khử duy nhất, ở đktc) có tỉ khối đối với H 2 bằng 22. Xác định khí NxOy và kim loại M. Câu 15 (B-08). Cho 2,16 gam Mg tác dụng với dung dịch HNO 3 (dư). Sau khi phản ứng xảy ra hoàn toàn thu được 0,896 lít khí NO (ở đktc) và dung dịch X. Tính khối lượng muối khan thu được khi làm bay hơi dung dịch X. Câu 16 (A-07). Hoà tan hoàn toàn 12 gam hỗn hợp Fe, Cu (tỷ lệ mol 1:1) bằng HNO 3, thu được V lít (đktc) hỗn hợp khí X (gồm NO và NO2) và dung dịch Y (chỉ chứa 2 muối và axit dư). Tỉ khối của X so với H2 bằng 19. Xác định giá trị của V. Câu 17 (B-07). Nung m gam bột sắt trong oxi, thu được 3 gam hỗn hợp chất rắn X. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư) thoát ra 0,56 lít (đktc) khí NO (là sản phẩm khử duy nhất). Xác định giá trị của m. Câu 18 (CĐA-08). Nhiệt phân hoàn toàn 34,65 gam hỗn hợp gồm KNO 3 và Cu(NO3)2, thu được hỗn hợp khí X (tỉ khối của X so với khí hiđro bằng 18,8). Tính khối lượng Cu(NO 3)2 trong hỗn hợp ban đầu. Câu 19 (A-2010). Hỗn hợp khí X gồm N2 và H2 có tỉ khối so với He bằng 1,8. Đun nóng X một thời gian trong bình kín (có bột Fe làm xúc tác), thu được hỗn hợp khí Y có tỉ khối so với He bằng 2. Tính hiệu suất của phản ứng tổng hợp NH3. Câu 20. Hỗn hợp A gồm N 2 và H2 với tỉ lệ mol 1: 3. Tạo phản ứng giữa N 2 và H2 cho ra NH3 với hiệu suất H% thu được hỗn hợp khí B. Tỉ khối của A so với B là 0,6. Tính giá trị của H. Câu 21 (B-2010). Một loại phân supephotphat kép có chứa 69,62% muối canxi đihiđrophotphat, còn lại gồm các chất không chứa photpho. Xác định độ dinh dưỡng của loại phân lân này. Câu 22. Hoà tan hoàn toàn m gam Cu trong dung dịch HNO3 thu được 1,12 lít hỗn hợp khí NO và NO2 (đktc) có tỉ khối hơi đối với H2 là 16,6. Xác định giá trị của m. CHUYÊN ĐỀ 3. CACBON - SILIC A. PHẦN LÝ THUYẾT I. CACBON 1. Vị trí - Cấu hình electron nguyên tử a. Vị trí - Cacbon ở ô thứ 6, chu kỳ 2, nhóm IVA của bảng tuần hoàn b. Cấu hình electron nguyên tử 1s22s22p2. C có 4 electron lớp ngoài cùng - Các số oxi hóa của C là: -4, 0, +2, +4 2. Tính chất vật lý - C có ba dạng thù hình chính: Kim cương, than chì và fuleren 3. Tính chất hóa học - Trong các dạng tồn tại của C, C vô định hình hoạt động hơn cả về mặt hóa học. - Trong các phản ứng hóa học C thể hiện hai tính chất: Tính oxi hóa và tính khử. Tuy nhiên tính khử vẫn là chủ yếu của C. a. Tính khử * Tác dụng với oxi Tài liệu ôn tập Hóa Học 11 17
  10. 0 +4 t0 C + O2  C O2 . Ở nhiệt độ cao C lại khử CO2 theo phản ứng 0 +4 +2 t0 C + CO2  2CO * Tác dụng với hợp chất 0 +4 t0 C + 4HNO3  C O2 + 4NO2 + 2H2O b. Tính oxi hóa * Tác dụng với hidro 0 -4 t0 , xt C+ 2H2  C H4 * Tác dụng với kim loại 0 -4 t0 3C+ 4Al  Al4 C3 (nhôm cacbua) II. CACBON MONOXIT 1. Tính chất hóa học - Tính chất hóa học đặc trưng của CO là tính khử +2 +4 t0 2CO + O2  2CO2 +2 +4 t0 3CO + Fe2O3  3CO2 + 2Fe 2. Điều chế a. Trong phòng thí nghiệm 0 H2SO4 (®Æc), t HCOOH  CO + H2O b. Trong công nghiệp: Khí CO được điều chế theo hai phương pháp * Khí than ướt 10500 C C + H2O  CO + H2 * Khí lò gas t0 C + O2  CO2 t0 CO2 + C  2CO III. CACBON ĐIOXIT 1. Tính chất a. Tính chất vật lý - Là chất khí không màu, nặng gấp 1,5 lần không khí. - CO2 (rắn) là một khối màu trắng, gọi là “nước đá khô”. Nước đá khô không nóng chãy mà thăng hoa, được dùng tạo môi trường lạnh không có hơi ẩm. b. Tính chất hóa học - Khí CO2 không cháy, không duy trì sự cháy của nhiều chất. - CO2 là oxit axit, khi tan trong nước cho axit cacbonic CO2 (k) + H2O (l)  H2CO3 (dd) - Tác dụng với dung dịch kiềm CO2 + NaOH → NaHCO3 CO2 + 2NaOH → Na2CO3 + H2O Tùy vào tỉ lệ phản ứng mà có thể cho ra các sản phẩm muối khác nhau. 2. Điều chế a. Trong phòng thí nghiệm CaCO3 + 2HCl → CaCl2 + CO2↑ + H2O b. Trong công nghiệp Tài liệu ôn tập Hóa Học 11 18
  11. - Khí CO2 được thu hồi từ quá trình đốt cháy hoàn toàn than. IV. AXIT CACBONIC - MUỐI CACBONAT 1. Axit cacbonic - Là axit kém bền, chỉ tồn tại trong dung dịch loãng, dễ bị phân hủy thành CO2 và H2O. - Là axit hai nấc, trong dung dịch phân li hai nấc.  + - H2CO3  H + HCO3 -  + 2- HCO3  H + CO3 2. Muối cacbonat - Muối cacbonat của các kim loại kiềm, amoni và đa số muối hiđrocacbonat đều tan. Muối cacbonat của kim loại khác thì không tan. - Tác dụng với dd axit NaHCO3 + HCl → NaCl + CO2↑ + H2O - + HCO3 + H → CO2↑ + H2O Na2CO3 + 2HCl → 2NaCl + CO2↑ + H2O 2- + CO3 + 2H → CO2↑ + H2O - Tác dụng với dd kiềm NaHCO3 + NaOH → Na2CO3 + H2O - - 2- HCO3 + OH → CO3 + H2O - Phản ứng nhiệt phân t0 MgCO3(r)  MgO(r) + CO2(k) t0 2NaHCO3(r)  Na2CO3(r) + CO2(k) + H2O(k) V. SILIC 1. Tính chất vật lý - Silic có hai dạng thù hình: silic tinh thể và silic vô định hình. 2. Tính chất hóa học - Silic có các số oxi hóa: -4, 0, +2 và +4 (số oxi hóa +2 ít đặc trưng hơn). - Trong các phản ứng hóa học, silic vừa thể hiện tính oxi hóa vừa thể hiện tính khử. a. Tính khử 0 +4 Si+ 2F2  Si F4 0 +4 t0 Si+ O2  SiO2 0 +4 Si+ 2NaOH + H2O  Na 2 SiO3 + 2H2  b. Tính oxi hóa 0 -4 t0 2Mg +Si  Mg2 Si 3. Điều chế - Khử SiO2 ở nhiệt độ cao t0 SiO2 + 2Mg  Si + MgO VI. HỢP CHẤT CỦA SILIC 1. Silic đioxit - SiO2 là chất ở dạng tinh thể. - Tan chậm trong dung dịch kiềm đặc nóng, tan dể trong kiềm nóng chãy. t0 SiO2 + 2NaOH  Na2SiO3 + H2O - Tan được trong axit HF Tài liệu ôn tập Hóa Học 11 19
  12. SiO2 + 4HF → SiF4 + 2H2O - Dựa vào tính chất này, người ta dùng dung dịch HF để khắc chử lên thủy tinh. 2. Axit silixic - H2SiO3 là chất ở dạng keo, không tan trong nước. Khi mất một phần nước tạo thành vật liệu xốp là silicagen. Dùng để hút hơi ẩm trong các thùng đựng hàng hóa. - Axit silixic là axit yếu, yếu hơn cả axit cacbinic nên bị axit này đẩy ra khỏi dung dịch muối. Na2SiO3 + CO2 + H2O → Na2CO3 + H2SiO3↓ 3. Muối silicat - Dung dịch đậm đặc của Na2SiO3 và K2SiO3 được gọi là thủy tinh lỏng. - Vải tẩm thủy tinh lỏng sẻ khó cháy, ngoài ra thủy tinh lỏng còn được dùng để chế tạo keo dán thủy tinh và sứ. B. BÀI TẬP CÓ HƯỚNG DẪN GIẢI I. Dạng bài tập CO2 tác dụng với dung dịch kiềm Các PTHH của các phản ứng xãy ra CO2 + NaOH→ NaHCO 3 CO2 + 2NaOH→ Na 2CO3 + H2O n OH Đặt T = : Nếu T ≤ 1→ tạo muối duy nhất NaHCO 3 n CO2 Nếu 1 < T < 2→ tạo hỗn hợp hai muối NaHCO 3 và Na2CO3 Nếu T ≥ 2→ tạo muối duy nhất Na 2CO3 Một số lưu ý khi giải bài tập này: - Xác định sản phẩm nào được tạo thành bằng các tính giá trị T. - Nếu tạo thành hỗn hợp hai muối thường ta giải bằng cách lập hệ PT. Ví dụ: Sục 2.24 lít khí CO 2 (đktc) vào 150 ml dung dịch NaOH 1M thu được dung dịch A. Tính khối lượng các chất tan trong A. Giải 2.24 n = = 0.1 (mol); n = 0.15*1 = 0.15 (mol) CO2 22.4 NaOH n 0.15 → T = OH = = 1.5 → tạo hỗn hợp hai muối n 0.1 CO2 Đặt n = x; n = y NaHCO3 Na2CO3 CO2 + NaOH→ NaHCO 3 x x x CO2 + 2NaOH→ Na 2CO3 + H2O y 2y y m = 0.05*84 = 4.2 (gam) x + y = 0.1 x = 0.05 NaHCO3 Ta có hệ PT: x + 2y = 0.15 y = 0.05 m = 0.05*106 = 5.3 (gam) Na2CO3 II. Dạng bài tập khử oxit kim loại bằng khí CO Oxit Kl + CO→ Kl + CO 2 → m + m = m + m oxit Kl CO Kl CO2 n = n n và m = m + m O (oxit) CO CO2 OxitKl Kl O Tài liệu ôn tập Hóa Học 11 20
  13. Ví dụ: Dẫn một luồng khí CO dư qua ống sứ đựng Fe 3O4 và CuO nung nóng đến khi phản ứng hoàn toàn thu được 2,32 gam hỗn hợp kim loại. Khí thoát ra khỏi bình được dẫn qua dung dịch nước vôi trong dư thu được 5 gam kết tủa. Tính tổng khối lượng 2 oxit trong hỗn hợp đầu. Giải 5 * Cách 1: n→ = 0.05 (mol) n = n = n = 0.05 (mol) CaCO3 100 O (oxit) CO2 CaCO3 moxit = mKl + mO = 2.32 + 16*0.05 = 3.12 (gam) 5 * Cách 2: n→ = 0.05 (mol) n = n = n = n = 0.05 (mol) CaCO3 100 O (oxit) CO2 CO CaCO3 m = m + m - m = 2.32 + 44*0.05 - 28*0.05 = 3.12 (gam) oxit Kl CO2 CO C. PHẦN BÀI TẬP CƠ BẢN Câu 1. Hoàn thành các PTHH của các phản ứng sau: a. NaHCO3 + NaOH b. NaHCO3 + HCl c. SiO2 + HF d. CO2 + NaOH 1 mol 1 mol e. CO2 + NaOH 1 mol 2 mol f. CO2 + Ca(OH)2 1 mol 1 mol g. CO2 + Ca(OH)2 2 mol 1 mol h. CO (dư) + Fe2O3 i. CO (dư) + Fe3O4 Câu 2. Đốt một mẩu than đá (chứa tạp chất không cháy) có khối lượng 0,6 gam trong oxi dư thu được 1,06 m3 (đktc) khí cacbonic. Tính thành phần % khối lượng của cacbon trong mẩu than đá trên. Câu 3. Cho 224 ml khí CO2 (đktc) hấp thụ hết trong 100 ml dung dịch KOH 0,2M. Tính khối lượng của những chất trong dung dịch tạo thành. Câu 4. Cho 5,6 lít khí CO2 (đktc) sục vào dung dịch NaOH dư thu được dung dịch A. Cô cạn dung dịch A thu được m gam muối. Tính giá trị m. Câu 5. Sục 2,24 lít khí CO 2 (đktc) vào 150 ml dung dịch NaOH 1M thu được dung dịch D. Tính khối lượng các chất tan trong dung dịch D. Câu 6. Sục 2,24 lít khí CO 2 (đktc) vào 200 ml dung dịch NaOH 1M thu được dung dịch D. Tính nồng độ mol/lít của các chất tan trong dung dịch D. Câu 7. Sục 4,48 lít khí CO2 (đktc) vào 400 ml dung dịch NaOH C M thu được dung dịch A. Cô cạn dung dịch A thu được 19 gam hỗn hợp hai muối. a. Tính khối lượng mỗi muối. b. Tính nồng độ dung dịch NaOH đem dùng. 0 Câu 8. Nung 52,65 gam CaCO3 ở 1000 C và cho toàn bộ khí thoát ra hấp thụ hết vào 500 ml dung dịch NaOH 1,8M. Hỏi thu được muối nào? Khối lượng là bao nhiêu. Biết hiệu suất của phản ứng nhiệt phân CaCO3 là 85%. Câu 9. Tính thể tích dung dịch NaOH 2M tối thiểu để hấp thụ hết 4,48 lít khí CO2 (đktc). Câu 10. Khử hoàn toàn 23,2 gam Fe3O4 bằng khí CO dư. Khí thu được sục vào dung dịch Ca(OH) 2 dư thu được m gam kết tủa. Tính m. Tài liệu ôn tập Hóa Học 11 21
  14. Câu 11. Khử hoàn toàn m gam Fe2O3 bằng khí CO dư. Khí thu được sục vào dung dịch Ca(OH)2 dư thu được 30 gam kết tủa. Tính m. Câu 12. Khử hoàn toàn 2,32 gam Fe3O4 bằng khí CO dư thu được m gam chất rắn. Hòa tan hoàn toàn chất rắn thu được bằng dung dịch axit HNO 3 thu được V lít NO (đktc) là sản phẩm khử duy nhất. Tính m và V. Câu 13. Khử hoàn toàn m gam gam Fe3O4 bằng V lít khí CO (vừa đủ) thu được chất rắn C. Hòa tan hoàn toàn chất rắn C thu được bằng dung dịch axit HNO 3 thu được 6,72 lít NO (đktc) là sản phẩm khử duy nhất. Tính m và V. Câu 14 (CĐA-09). Khử hoàn toàn một oxit sắt X ở nhiệt độ cao cần vừa đủ V lít khí CO (ở đktc), sau phản ứng thu được 0,84 gam Fe và 0,02 mol khí CO2. Công thức của X và giá trị V lần lượt là D. PHẦN BÀI TẬP NÂNG CAO Câu 1. Dẫn một luồng khí CO dư qua ống sứ đựng Fe3O4 và CuO nung nóng đến khi phản ứng hoàn toàn thu được 2,32 gam hỗn hợp kim loại. Khí thoát ra khỏi bình được dẫn qua dung dịch nước vôi trong dư thu được 5 gam kết tủa. Tính tổng khối lượng 2 oxit trong hỗn hợp đầu. Câu 2. Cho khí CO qua ống chứa 15,2g hỗn hợp gồm CuO và FeO nung nóng. Sau một thời gian thu được hỗn hợp khí B và 13,6g chất rắn C. Cho B tác dụng với dung dịch Ca(OH)2 dư thu được m gam kết tủa. Xác định giá trị của m. Câu 3. Dẫn một luồng khí CO qua ống sứ đựng m gam hỗn hợp CuO, Fe 2O3, Fe3O4 và Al2O3 rồi cho khí thoát ra hấp thụ hết vào dung dịch nước vôi trong dư thu được 15 gam kết tủa. Chất rắn còn lại trong ống sứ có khối lượng 215,0 gam. Xác định giá trị của m. Câu 4. Cho V lít khí CO2 (đktc) hấp thụ hết vào 500 ml dung dịch Ca(OH)2 0,02 M thì thu được 0,5 gam kết tủa. Xác định giá trị tối thiểu của V. Câu 5. Cho 1,344 lít khí CO2 (đktc) hấp thụ hết vào 2 lít dung dịch X chứa NaOH 0,04M và Ca(OH)2 0,02M thu được m gam kết tủa. Xác định giá trị của m. Câu 6. Hoà tan hoàn toàn 11,2 gam CaO vào H2O thu được dung dịch A. Sục V lít khí CO 2 (đktc) vào dung dịch A thu được 15 gam kết tủa. Xác định giá trị của V. Câu 7 (CĐ-2010). Hấp thụ hoàn toàn 3,36 lít khí CO 2 (đktc) vào 125 ml dung dịch Ba(OH)2 1M, thu được dung dịch X. Coi thể tích dung dịch không thay đổi. Xác định nồng độ mol của chất tan trong dung dịch X. Câu 8 (A-09). Cho 0,448 lít khí CO2 (ở đktc) hấp thụ hết vào 100 ml dung dịch chứa hỗn hợp NaOH 0,06M và Ba(OH)2 0,12M, thu được m gam kết tủa. Tính giá trị của m. Câu 9 (A-08). Hấp thụ hoàn toàn 4,48 lít khí CO 2 (ở đktc) vào 500 ml dung dịch hỗn hợp gồm NaOH 0,1M và Ba(OH)2 0,2M, sinh ra m gam kết tủa.Tính giá trị của m. Câu 10 (A-07). Hấp thụ hoàn toàn 2,688 lít khí CO2 (đktc) vào 2,5 lít dung dịch Ba(OH)2 nồng độ a mol/l, thu được 15,76 gam kết tủa. Tính giá trị của a. Câu 11 (CĐA-08). Dẫn từ từ V lít khí CO (ở đktc) đi qua một ống sứ đựng lượng dư hỗn hợp rắn gồm CuO, Fe2O3 (ở nhiệt độ cao). Sau khi các phản ứng xảy ra hoàn toàn, thu được khí X. Dẫn toàn bộ khí X ở trên vào lượng dư dung dịch Ca(OH)2 thì tạo thành 4 gam kết tủa. Tính giá trị của V. Câu 12 (A-09). Cho luồng khí CO (dư) đi qua 9,1 gam hỗn hợp gồm CuO và Al 2O3 nung nóng đến khi phản ứng hoàn toàn, thu được 8,3 gam chất rắn. Tính khối lượng CuO có trong hỗn hợp ban đầu. Câu 13 (A-08). Cho V lít hỗn hợp khí (ở đktc) gồm CO và H 2 phản ứng với một lượng dư hỗn hợp rắn gồm CuO và Fe3O4 nung nóng. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng hỗn hợp rắn giảm 0,32 gam. Xác định giá trị của V. CHUYÊN ĐỀ 4. ĐẠI CƯƠNG VỀ HÓA HỮU CƠ A. PHẦN LÝ THUYẾT Tài liệu ôn tập Hóa Học 11 22
  15. I. MỞ ĐẦU VỀ HÓA HỌC HỮU CƠ 1. Khái niệm về hợp chất hữu cơ và hóa học hữu cơ - Hợp chất hữu cơ là hợp chất của cacbon (trừ CO, CO2, muối cacbonat ). - Hóa học hữu cơ là nghành hóa học nghiên cứu các hợp chất hữu cơ. 2. Phân loại hợp chất hữu cơ - Thường chia thành hai loại + Hiđrocacbon + Dẫn xuất hiđrocacbon 3. Đặc điểm chung của hợp chất hữu cơ - Đặc điểm cấu tạo: Liên kết hóa học chủ yếu trong hợp chất hữu cơ là liên kết cộng hóa trị. - Tính chất vật lý: + Nhiệt độ nóng chãy, nhiệt độ sôi thấp. + Phần lớn không tan trong nước, nhưng tan nhiều trong các dung môi hữu cơ. - Tính chất hóa học: + Các hợp chất hữu cơ thường kém bền với nhiệt và dể cháy. + Phản ứng hóa học của các hợp chất hữu cơ thường xãy ra chậm và theo nhiều hướng khác nhau, nên tạo ra hỗn hợp nhiều sản phẩm. 4. Sơ lược về phân tích nguyên tố a. Phân tích định tính * Mục đích: Xác định nguyên tố nào có trong hợp chất hữu cơ. * Nguyên tắc: Chuyển các nguyên tố trong hợp chất hữu cơ thành các chất vô cơ đơn giản rồi nhận biết chúng bằng các phản ứng đặc trưng. b. Phân tích định lượng * Mục đích: Xác định thành phần % về khối lượng các nguyên tố có trong phân tử hợp chất hữu cơ. * Nguyên tắc: Cân chính xác khối lượng hợp chất hữu cơ, sau đó chuyển nguyên tố C → CO 2, H → H2O, N → N2, sau đó xác định chính xác khối lượng hoặc thể tích của các chất tạo thành, từ đó tính % khối lượng các nguyên tố. * Biểu thức tính toán: m .12 m .2 V .28 m = CO2 (g) ;;m = H2O (g) m = N2 (g) C 44 H 18 N 22,4 m .100 m .100 m .100 - Tính được: %C = C ; %H = H ; %N = N ; %O = 100-%C-%H-%N a a a II. CÔNG THỨC PHÂN TỬ HỢP CHẤT HỮU CƠ 1. Công thức đơn giản nhất a. Định nghĩa - Công thức đơn giản nhất là công thức biểu thị tỉ lệ tối giản về số nguyên tử của các nguyên tố trong phân tử. b. Cách thiết lập công thức đơn giản nhất - Thiết lập công thức đơn giản nhất của hợp chất hữu cơ CxHyOz là thiết lập tỉ lệ m m m %C %H %O x : y : z = n : n : n = C : H : O ; x : y : z = : : C H O 12 1 16 12 1 16 2. Công thức phân tử a. Định nghĩa - Công thức phân tử là công thức biểu thị số lượng nguyên tử của mỗi nguyên tố trong phân tử. b. Cách thiết lập công thức phân tử - Có ba cách thiết lập công thức phân tử * Dựa vào thành phần % khối lượng các nguyên tố (ít dùng) - Cho CTPT CxHyOz: ta có tỉ lệ Tài liệu ôn tập Hóa Học 11 23
  16. M 12.x 1.y 16.z = = = 100 %C %H %O M.%C M.%H M.%O Từ đó ta có: x = ; y = ; z = 12.100 1.100 16.100 * Dựa vào công thức đơn giản nhất (thường dùng) * Tính trực tiếp theo khối lượng sản phẩm cháy (ít dùng) B. HƯỚNG DẪN GIẢI BÀI TẬP Phần bài tập chương này chủ yếu là lập CT đơn giản nhất và CTPT. Một số công thức sau yêu cầu chúng ta phải nắm để vận dụng trong việc giải bài tập chương này. Cho hợp chất X có CT: CxHyOzNt. mO * n = n ; n = 2n ; n = 2n ; mO = mX - (mC + mH + mN) → n = C CO2 H H2O N N2 O 16 → x : y : z : t = nC : nH : nO : nN. MA * dA/B = MA = dA/B *MB MB Ví dụ: Đốt cháy hoàn toàn 2,46 gam chất hữu cơ (A) thu được 5,28 gam CO 2, 0,9 gam H2O và 224ml N2 (đo đktc). Tỉ khối hơi của (A) so với không khí là 4, 24. Xác định công thức phân tử của (A). Giải Đặt CT đơn giản nhất của A là CxHyOzNt 5.28 0.9 0.224 n = n = = 0.12 (mol) ;n = 2* n = 2* = 0.1 (mol) ; n = 2n = 2* = 0.02 (mol) C CO2 44 H H2O 18 N N2 22.4 mO = mA - (mC + mH + mN) = 2.46 – (0.12*12+0.1*1+0.02*14) = 0.64 (gam) m 0.64 → n = O = = 0.04 (mol) O 16 16 → x : y : z : t = nC : nH : nO : nN = 0.12 : 0.1 : 0.04 : 0.02 = 6 : 5 : 2 : 1 → CT đơn giản nhất của A là: C6H5O2N M d = A M = d *29 = 123 từ đó ta suy ra: CT đơn giản nhất chính là CTPT. A/kk 29 A A/B → CTPT của A là: C6H5O2N C. BÀI TẬP VẬN DỤNG Câu 1. Oxi hóa hoàn toàn 0,6 gam hợp chất hữu cơ A thu được 0,672 lít CO 2 (đktc) và 0,72 gam H2O. Tính % khối lượng các nguyên tố trong phân tử chất A. Câu 2. Oxi hóa hoàn toàn 0,67 gam β-caroten rồi dẫn sản phẩm oxi hóa qua bình 1 đựng dd H 2SO4 đặc, sau đó qua bình 2 đựng Ca(OH)2 dư. Kết quả cho thấy khối lượng bình 1 tăng 0,63 gam; bình 2 có 5 gam kết tủa. Tính % khối lượng các nguyên tố trong phân tử β-caroten. Câu 3. Tính khối lượng mol phân tử của các chất sau: a. Chất A có tỉ khối hơi so với không khí bằng 2,07. b. Thể tích hơi của 3,3 gam chất X bằng thể tích của 1,76 gam khí oxi (đo ở cùng điều kiện). Câu 4. Kết quả phân tích nguyên tố cho thấy limonen được cấu tạo từ hai nguyên tố C và H, trong đó C chiếm 88,235% về khối lượng. Tỉ khối hơi của limonen so với không khí gần bằng 4,69. Lập công thức phân tử của limonen. Câu 5. Đốt cháy hoàn toàn 0,3 gam chất A (phân tử chỉ chứa C, H, O) thu được 0,44 gam khí CO 2 và 0,18 gam nước. Thể tích hơi của 0,3 gam chất A bằng thể tích của 0,16 gam khí oxi (đo ở cùng điều kiện). Xác định công thức phân tử của chất A. Tài liệu ôn tập Hóa Học 11 24
  17. Câu 6. Anetol có khối lượng mol phân tử bằng 148 g/mol. Phân tích nguyên tố cho thấy anetol có %C=81,08%; %H=8,1%, còn lại là oxi. Lập công thức đơn giản nhất và công thức phân tử của anetol. Câu 7. Hợp chất X có % khối lượng C, H và O lần lượt là 54,54%, 8,1% và 36,36%. Khối lượng phân tử của X là 88g/mol. Lập công thức phân tử của X. Câu 8. Hợp chất Z có công thức đơn giản nhất là CH 3O và có tỉ khối hơi so với hidro là 31. Xác định công thức phân tử của Z. Câu 9. Đốt cháy hoàn toàn 2,46 gam chất hữu cơ (A) thu được 5,28 gam CO 2, 0,9 gam H2O và 224ml N2 (đo đktc). Tỉ khối hơi của (A) so với không khí là 4, 24. Xác định công thức phân tử của (A). Câu 10. Đốt cháy hoàn toàn 5,6 lít chất khí hữu cơ, thì thu được 16,8lít CO 2 và 13,5 gam H2O. Các chất khí (đo đktc). Lập công thức phân tử, biết rằng 1 lít khí chất hữu cơ ở đktc nặng 1,875 gam. Câu 11. Đốt cháy hoàn toàn 0,1 mol hợp chất hữu cơ (D) cần vừa đủ 14,4 gam oxi, thấy sinh ra 13,2 gam CO2 và 7,2 gam nước. a. Tìm phân tử khối cuả (D). b. Xác định công thức phân tử của (D). Câu 12. Đốt a gam chất (X) cần 0,3 mol O 2 thu được 0,2 mol CO2, 0,3 mol H2O. Hãy xác định a gam, công thức đơn giản của (X)? Câu 13. Đốt cháy hoàn toàn 9,9 gam chất hữu cơ (A) gồm 3 nguyên tố C, H và Cl. Sản phẩm tạo thành cho qua bình đựng H2SO4 đậm đặc và Ca(OH)2 thì thấy khối lượng các bình nầy tăng lần lượt là 3,6 gam và 8,8 gam. a. Tìm công thức nguyên (A). b. Xác định CTPT, biết (A) chỉ chứa 2 nguyên tử Clo. Câu 14. Đốt cháy hoàn toàn 112 cm3 một hydrocacbon (A) là chất khí ở (đktc) rồi dẫn sản phẩm lần lượt qua bình (I) đựng H2SO4 đậm đặc và bình (II) chứa KOH dư người ta thấy khối lượng bình (I) tăng 0,18 gam và khối lượng bình (II) tăng 0,44 gam. Xác định CTPT (A). 3 Câu 15. Đốt cháy hoàn toàn hợp chất hữu cơ gồm C, H, Cl, sinh ra 112 cm CO2 (đo đktc) và 0,09 gam H2O. Cũng từ hợp chất hưữ cơ đó cho tác dụng AgNO 3 thì thu được 1,435 AgCl. Lập CTPT chất hữu cơ. Biết rằng tỉ khối hơi chất đó so với He là 21,25. Câu 16. Một chất hữu cơ có tỉ lệ khối lượng m C : mH : mO = 12 : 2,5 : 4. Biết rằng cứ 0,1 mol chất hữu cơ có khối lượng 7,4 gam. a. Lập CTPT chất hữu cơ. b. Viết CTCT các đồng phân. Câu 17. Đốt cháy hoàn toàn 1,608 gam Chất (A), thu được 1,272 gam Na2CO3, 0,528gam CO2. Lập CTPT (A). Biết rằng trong phân tử chỉ chứa 2 nguyên tử Na. CHUYÊN ĐỀ 5: HIDROCACBON NO A. PHẦN LÝ THUYẾT I. ANKAN 1. Khái niệm - Đồng đẵng - Đồng phân - Danh pháp a. Khái niệm - Ankan là hidrocacbon no mạch hở có CTTQ CnH2n+2 (n≥1). Hay còn gọi là Parafin Tài liệu ôn tập Hóa Học 11 25
  18. - Các chất CH4, C2H6, C3H8 . CnH2n+2 hợp thành dãy đồng đẵng của ankan. b. Đồng phân - Từ C4H10 trở đi có đồng phân cấu tạo (đồng phân mạch C). - Thí dụ: C5H10 có ba đồng phân: CH3-CH2-CH2-CH2CH3; CH3-CH(CH3)-CH2-CH3; CH3-C(CH3)2-CH3 c. Danh pháp - Nắm tên các ankan mạch không nhánh từ C1 → C10 - Danh pháp thường. - n - tên ankan tương ứng (n- ứng với mạch C không phân nhánh) - iso - tên ankan tương ứng (iso- ở C thứ hai có nhánh -CH3). - neo - tên ankan tương ứng (neo- ở C thứ hai có hai nhánh -CH3). - Danh pháp quốc tế: Số chỉ vị trí nhánh + tên nhánh + tên mạch C chính + an 1 2 3 4 Thí dụ: CH3 - CH(CH3 ) - CH2 - CH3 (2-metylbutan) - Bậccủa nguyên tử C trong hiđrocacbon no được tính bằng số liên kết của nó với các nguyên tử C khác. I IV III II I Thí dụ: CH3 - C(CH3 )2 - CH(CH3 ) - CH2 - CH3 2. Tính chất vật lý - Từ CH4 → C4H10 là chất khí. - Từ C5H12 → C17H36 là chất lỏng. - Từ C18H38 trở đi là chất rắn. 3. Tính chất hóa học a. Phản ứng thế bởi halogen (đặc trưng cho hidrocacbon no) - Clo có thể thế lần lượt từng nguyên tử H trong phân tử metan askt CH4 + Cl2  CH3Cl + HCl askt CH3Cl + Cl2  CH2Cl2 + HCl askt CH2Cl2 + Cl2  CHCl3 + HCl askt CHCl3 + Cl2  CCl4 + HCl - Các đồng đẵng của metan cũng tham gia phản ứng thế tương tự metan Thí dụ CH3-CH2-CH2Cl as 1-clopropan (43%) CH3-CH2-CH3 0 25 C CH3-CHCl-CH3 2-clopropan (57%) - Nhận xét: Nguyên tử H liên kết với nguyên tử C bậc cao hơn dể bị thế hơn nguyên tử H liên kết với nguyên tử C bậc thấp hơn. b. Phản ứng tách. t0 , xt Cn H2n+2  Cn H2n + H2 t0 , xt Cn H2n+2  Cn'H2n' + CmH2m+2 (n = n' + m) - Thí dụ 5000 C, xt CH3-CH3  CH2=CH2 + H2 CH4 + C3H6 t0C, xt C4H10 C2H4 + C2H6 C4H8 + H2 - Phản ứng oxi hóa. Tài liệu ôn tập Hóa Học 11 26
  19. 3n +1 CnH2n+2 + O2 → nCO2 + nH2O (n >n ) 2 H2O CO2 4. Điều chế: a. Phòng thí nghiệm: CaO, t0 - CH3COONa + NaOH  CH4↑ + Na2CO3 - Al4C3 + 12H2O → 3CH4↑ + 4Al(OH)3 b. Trong công nghiệp: Đi từ khí thiên nhiên, khí mỏ dầu và từ dầu mỏ. II. XICLOANKAN 1. Khái niệm - Danh pháp a. Khái niệm - Xicloankan là một loại hiđrocacbon no mà trong phân tử chỉ gồm liên kết đơn và có một vòng khép kín. Có CTTQ là CnH2n (n≥3). - Thí dụ: (xiclopropan) (xiclobutan) b. Danh pháp: Số chỉ vị trí nhánh + tên nhánh + xicol + tên mạch C chính (vòng) + an - Thí dụ: -CH3 (metylxiclopropan) 2. Tính chất hóa học a. Phản ứng thế b. Phản ứng cộng mở vòng - Cộng H2: Chỉ có Xiclopropan và xiclobutan - Cộng Br2 và HX (X: Cl, Br): Chỉ có xicolpropan c. Phản ứng tách - Thường chỉ có xiclohexan và metylxiclohexan. d. Phản ứng oxi hóa: 3n t0 CnH2n + O2  nCO2 + nH2O 2 3. Điều chế: - Được điều chế từ việc chưng cất dầu mỏ. Ngoài ra còn được điều chế từ ankan tương ứng. B. BÀI TẬP CÓ HƯỚNG DẪN GIẢI Phần bài tập ankan là phần bài tập cơ bản, làm nền tảng để ta giải các bài tập hóa học sau này. Do vậy yêu cầu chúng ta cần phải nắm chắc để vận dụng khi ta gặp các dãy đồng đẵng khác. Ở chương này chủ yếu ta giải quyết dạng bài tập lập công thức phân tử của ankan. CTPT của ankan là: CnH2n+2. Để lập CTPT của ankan ta có thể sử dụng một trong các cách sau (tùy bài ra mà ta sẽ có các cách giải phù hợp): * Cách 1: M = 14n + 2. M ta có thể tính bằng nhiều cách khác nhau tùy vào dử kiện bài ra. nCO * Cách 2: n = 2 . Lưu ý: Công thức này ta có thể áp dụng cho mọi dãy đồng đẵng mà ta sẽ gặp nankan n n sau này. n = n - n n = CO2 = CO2 ankan H2O CO2 n n n ankan H2O CO 2 * Cách 3: Ta lập tỉ lệ trên PTHH để đưa ra phương trình bậc nhất một ẩn (ẩn đó là n). Từ đó tính giái trị n. * Lưu ý: Nếu là hỗn hợp hai ankan đồng đẵng kế tiếp của nhau thì ta quy thành một ankan có CT là C nH2n 2 . Từ đó tính giá trị n . Tài liệu ôn tập Hóa Học 11 27
  20. Ví dụ 1: Đốt cháy hỗn hợp hai hidrocacbon đồng đẳng kế tiếp nhau ta thu được 11,7g H2O và 17,6g CO2. Xác định CTPT của hai hidrocacbon trên. Giải Đặt CTPT của 2 ankan là C nH2n 2 . 17.6 11.7 n = = 0.4 (mol); n = 0.65 (mol) CO2 44 H2O 18 n n CO2 CO2 0.4 n = = = = 1.6 . Từ đó suy ra CTPT của hai ankan là: CH4 và C2H6. n n n 0.65 0.4 ankan H2O CO 2 Ví dụ 2: Đốt cháy hoàn toàn 3,36 lít hỗn hợp khí metan và etan thu được 4,48 lít khí CO 2 (đktc). Tính thành phần phần trăm về thể tích của mỗi khí trong hỗn hợp A. Giải 3.36 4.48 n = = 0.15 (mol); n = = 0.2 (mol) hh 22.4 CO2 22.4 Đặt n = a, n = b CH4 C2H6 CH4 CO2 a a C2H6 2CO2 b 2b 0.1 a + b = 0.15 a = 0.1 %CH = *100 = 66.67 (%) Ta có hệ PT: 4 0.15 a + 2b = 0.2 b = 0.05 %C2H6 = 100 - 66.67 = 33.33 (%) C. PHẦN BÀI TẬP CƠ BẢN Câu 1. Viết công thức cấu tạo các đồng phân ankan ứng với công thức phân tử C 4H10, C5H12 và C6H14. Gọi tên theo danh pháp thường và tên thay thế. Câu 2. Viết CTCT của các ankan có tên sau: a. pentan, 2-metylbutan, isobutan và 2,2-đimetylbutan. b. iso-pentan, neo-pentan, 3-etylpentan, 2,3-đimetylpentan. Câu 3. Gọi tên các chất sau theo danh pháp thường và danh pháp thay thế: a. CH3-CH(CH3)-CH3; b. CH3-(CH2)4-CH3 c. CH3-CH(CH3)-CH2-CH3; d. CH3-C(CH3)2-CH3 Câu 4. Gọi tên các chất sau theo danh pháp thay thế. a. CH3-CH2-CH2-CH2-CH(CH3)-CH3 b. CH3-CH2-CH(C2H5)-CH2-CH3 c. CH3-CH2-C(CH3)2-CH3 d. CH3-CH(C2H5)-CH2-CH2-CH3 Câu 5. Hoàn thành các PTHH của các phản ứng sau: askt a. CH4 + Cl2  1 mol 1 mol askt b. C2H6 + Cl2  1 mol 1 mol askt c. CH3-CH2-CH3 + Br2  1 mol 1 mol t0 d. CH4 + O2  CaO, t0 e. CH3COONa + NaOH  f. Al4C3 + H2O Tài liệu ôn tập Hóa Học 11 28
  21. Câu 6. Viết PTHH điều chế các ankan sau từ các chất tương ứng. Metan, 2-clobutan, iso-propyl clorua. Câu 7 (A-08). Cho iso-pentan tác dụng với Cl2 (askt) theo tỉ lệ số mol 1 : 1. a. Xác định số sản phẩm monoclo tối đa thu được. b. Viết PTHH tạo các sản phẩm mono clo tương ứng đó. Câu 8. Khi clo hóa C5H12 với tỷ lệ mol 1:1 thu được một sản phẩm thế monoclo duy nhất. a. Xác định CTCT và danh pháp IUPAC của ankan đó. b. Viết PTHH của phản ứng xãy ra. Câu 9. Khi clo hóa một ankan có công thức phân tử C 6H14, người ta chỉ thu được 2 sản phẩm thế monoclo. a. Xác định CTCT và danh pháp IUPAC của ankan đó. b. Viết PTHH của các phản ứng xãy ra. Câu 10. Ankan Y mạch không nhánh có công thức đơn giản nhất là C2H5. a. Tìm công thức phân tử, viết CTCT và gọi tên Y. b. Viết PTHH phản ứng của Y với Clo khi chiếu sáng (tỉ lệ 1:1), chỉ rỏ sản phẩm chính. Câu 11. Đốt cháy hoàn toàn 4,48 lít C3H8 (đktc) thu được V lít CO2 (đktc) và m gam nước. Tính m và V. Câu 12. Đốt cháy hoàn toàn V lít khí C4H10 (đktc). Toàn bộ sản phẩm cháy sục vào dung dịch nước vôi trong dư thu được 40 gam kết tủa. a. Tính V. b. Tính khối lượng muối thu được. Câu 13. Đốt cháy hoàn toàn một hidrocacbon X thu được 8,96 lít khí CO 2 (đktc) và 9 gam nước. Xác định công thức của X. Câu 14. Đốt cháy hoàn toàn 2,24 lít ankan X (đktc) thu được 6,72 lít khí CO 2 (đktc) và m gam nước. a. Tính khối lượng muối thu được. b. Xác định công thức của X. Câu 15. Khi đốt cháy hoàn toàn một ankan A thì thể tích Oxi phản ứng bằng 5/3 lần thể tích của khí CO2 sinh ra trong cùng điều kiện. Xác định công thức của ankan A. Câu 16. Đốt cháy hoàn toàn 2,24 lít ankan B (đktc) cần 11,2 lít O2 (đktc). a. Xác định công thức của B. b. Tính khối lượng CO2 và nước sinh ra. Câu 17. Đốt cháy hoàn toàn 3,36 lít hỗn hợp khí metan và etan thu được 4,48 lít khí CO 2 (đktc). Tính thành phần phần trăm về thể tích của mỗi khí trong hỗn hợp A. Câu 18. Xicloankan đơn vòng X có tỉ khối hơi so với nitơ bằng 2. Lập công thức phân tử của X. Câu 19. Khi đốt cháy hoàn toàn 3.6 gam ankan X thu được 5.6 lít CO 2 (đktc). Xác định công thức phân tử của X. Câu 20. Đốt cháy hoàn toàn 4,48 lít hỗn hợp gồm C 2H6 và C3H8 ( đktc) rồi cho sản phẩm cháy đi qua bình 1 đựng dung dịch H2SO4 đặc, bình 2 đựng dung dịch nước vôi trong có dư thấy khối lượng bình 1 tăng m g, bình 2 tăng 22 g. a. Xác định giá trị của m. b. Tính % thể tích mỗi khí trong hỗn hợp đầu. Câu 21. Đốt cháy hoàn toàn m g hỗn hợp gồm CH 4, C2H6 và C4H10 thu được 3,3g CO 2 và 4,5 g H2O. Xác định giá trị của m. Câu 22. Một hỗn hợp 2 ankan kế tiếp có khối lượng 24,8 gam có thể tích tương ứng là 11,2 lít (ở đktc). Xác định CTPT của 2 ankan. Câu 23. Đốt cháy hỗn hợp hai hidrocacbon đồng đẳng kế tiếp nhau ta thu được 11,7g H 2O và 17,6g CO2. Xác định CTPT của hai hidrocacbon trên. Tài liệu ôn tập Hóa Học 11 29
  22. Câu 24. Khi đốt cháy hoàn toàn 7,84 lít hỗn hợp khí gồm CH 4, C2H6, C3H8 (đktc) thu được 16,8 lít khí CO2 (đktc) và x gam H2O. Xác định giá trị của X. Câu 25. Đốt cháy hoàn toàn 11,2 lít hỗn hợp propan và butan (đktc) rồi cho tất cả sản phẩm cháy thu được vào dung dịch NaOH thì thu được 95,4 gam Na2CO3 và 84 gam NaHCO3. a. Tính thành phần % về số mol của hỗn hợp. b. Tìm thể tích dung dịch NaOH 0,5 M cần thiết dùng trong trường hợp trên. Câu 26. Đốt cháy hoàn toàn 0,01 mol ankan (A). Dẫn toàn bộ sản phẩm cháy qua bình Ca(OH) 2 dư người ta thu được 4 gam kết tủa. a. Tìm công thức phân tử của Ankan (A). b. B là đồng đẳng liên tiếp của A. B tác dụng với clo (askt) theo tỉ lệ mol 1:1. Người ta thu được 4 sản phẩm. Hãy xác định CTCT đúng của (B). Câu 27. Một hỗn hợp gồm 2 ankan X và Y là đồng đẳng kế tiếp nhau có khối lượng 10,2 gam. Đốt cháy hoàn toàn hỗn hợp cần 36,8 gam O2. a. Tính khối lượng CO2 và H2O tạo thành. b. Tìm CTPT của 2 ankan. Câu 28. Khi tiến hành craking 22,4 lít khí C4H10 (đktc) thu được hỗn hợp A gồm CH 4, C2H6, C2H4, C3H6, C4H8, H2 và C4H10 dư. Đốt cháy hoàn toàn A thu được x gam CO 2 và y gam H2O. Xác định giá trị của x và y. Câu 29. Hỗn hợp (X) gồm 2 ankan A, B liên tiếp nhau trong dãy đồng đẳng có dX/He = 16,6 . Xác định CTPT của A, B và tính % V của hỗn hợp. Câu 30. Một ankan có thành phần % các nguyên tố: %C = 84,21; %H = 15,79. Tỉ khối hơi của ankan đối với không khí là 3,93. Xác định CTPT ankan. Câu 31. Đốt cháy hoàn toàn 3,6 g một ankan A thu được 11g CO2 và 5,4g nước. Khi clo hóa A theo tỉ lệ mol 1:1 tạo thành dẫn xuất monoclo duy nhất. Xác định CTPT và CTCT của A. D. PHẦN BÀI TẬP NÂNG CAO Câu 1. Hỗn hợp khí X gồm 2 hiđrocacbon A và B là đồng đẳng kế tiếp. Đốt cháy X với 64 gam O 2 (dư) rồi dẫn sản phẩm thu được qua bình đựng Ca(OH) 2 dư thu được 100 gam kết tủa. Khí ra khỏi bình có thể tích 11,2 lít ở 0OC và 0,4 atm. Xác định công thức phân tử của A và B. Câu 2 (A-2010). Đốt cháy hoàn toàn một lượng hiđrocacbon X. Hấp thụ toàn bộ sản phẩm cháy vào dung dịch Ba(OH)2 (dư) tạo ra 29,55 gam kết tủa, dung dịch sau phản ứng có khối lượng giảm 19,35 gam so với dung dịch Ba(OH)2 ban đầu. Xác định công thức phân tử của X. Câu 3. Đốt cháy hoàn toàn một hiđrocacbon X thu được 0,11 mol CO2 và 0,132 mol H2O. Khi X tác dụng với khí clo (theo tỉ lệ số mol 1:1) thu được một sản phẩm hữu cơ duy nhất. Xác định tên gọi của X. Câu 4 (B-08). Hiđrocacbon mạch hở X trong phân tử chỉ chứa liên kết δ và có hai nguyên tử cacbon bậc ba trong một phân tử. Đốt cháy hoàn toàn 1 thể tích X sinh ra 6 thể tích CO 2 (ở cùng điều kiện nhiệt độ, áp suất). Cho X tác dụng với Cl2 (theo tỉ lệ số mol 1:1). a. Xác định số dẫn xuất monoclo tối đa sinh ra. b. Viết PTHH của các phản ứng xãy ra. Câu 5 (A-08). Khi crackinh hoàn toàn một thể tích ankan X thu được ba thể tích hỗn hợp Y (các thể tích khí đo ở cùng điều kiện nhiệt độ và áp suất); tỉ khối của Y so với H 2 bằng 12. Xác định công thức phân tử của X. Câu 6 (A-07). Khi brom hoá một ankan chỉ thu được một dẫn xuất monobrom duy nhất có tỷ khối hơi so với hiđro là 75,5. Xác định tên của ankan đó. Câu 7. Khi đốt cháy hoàn toàn hỗn hợp 2 ankan là đồng đẳng kế tiếp thu được 7,84 lít khí CO 2 (đktc) và 9,0 gam H2O. Xác định công thức phân tử của 2 ankan. Tài liệu ôn tập Hóa Học 11 30
  23. Câu 8. Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai hidrocacbon thuộc cùng dãy đồng đẵng cần dùng 6.16 lít O2 (đkc) và thu được 3.36 lít CO2 (đkc). Tính giá trị của m. CHUYÊN ĐỀ VI. HIDROCACBON KHÔNG NO - HIDROCACBON THƠM A. PHẦN LÝ THUYẾT I. ANKEN 1. Khái niệm - Đồng phân - Danh pháp a. Khái niệm: - Anken là hidrocacbon không no mạch hở có một nối đôi trong phân tử. Có CTTQ là CnH2n (n 2 ) - Các chất C2H4, C3H6, C4H8 . . . CnH2n (n≥2) hợp thành dãy đồng đẵng của anken. b. Đồng phân: Có hai loại đồng phân - Đồng phân cấu tạo: (Đồng phân mạch C và đồng phân vị trí liên kết đôi) Thí dụ: C4H8 có ba đồng phân cấu tạo. CH2=CH-CH2-CH3; CH3-CH=CH-CH3; CH2=C(CH3)-CH3 - Đồng phân hình học (cis - trans): Cho anken có CTCT: abC=Ccd. Điều kiện để xuất hiện đồng phân hình học là: a ≠ b và c ≠ d. Thí dụ: CH3-CH=CH-CH3 có hai đồng phân hình học H CH3 H3 CH3 C=C C C=C H3C H H H trans - but-2-en cis - but-2-en c. Danh pháp: - Danh pháp thường: Tên ankan nhưng thay đuôi an = ilen. + Ví dụ: C2H4 (Etilen), C3H6 (propilen) - Danh pháp quốc tế (tên thay thế): Số chỉ vị trí nhánh + tên nhánh + tên mạch C chính + số chỉ vị trí liên kết đôi + en 4 3 2 1 + Ví dụ: CH3 - CH = CH - CH3 (C4H8) But-2-en 1 2 3 CH2 = C(CH3 ) - CH3 (C4H8) 2 - Metylprop-1-en 2. Tính chất vật lý Ở điều kiện thường thì - Từ C2H4 → C4H8 là chất khí. - Từ C5H10 trở đi là chất lỏng hoặc chất rắn. 3. Tính chất hóa học a. Phản ứng cộng (đặc trưng) Ni, t0 * Cộng H2: CnH2n + H2  CnH2n+2 Ni, t0 CH2=CH-CH3 + H2  CH3-CH2-CH3 * Cộng Halogen: CnH2n + X2 CnH2nX2 CH2=CH2 + Br2 CH2Br-CH2Br Phản ứng anken tác dụng với Br2 dùng để nhận biết anken (dd Br2 mất màu) * Cộng HX (X: Cl, Br, OH . . .) H+ Thí dụ: CH2=CH2 + HOH  CH3-CH2OH CH2=CH2 + HBr  CH3-CH2Br - Các anken có cấu tạo phân tử không đối xứng khi cộng HX có thể cho hỗn hợp hai sản phẩm CH3-CH2-CH2Br (spp) 1-brompropan CH3-CH=CH2 + HBr CH -CHBr-CH (spc) Tài liệu ôn tập Hóa Học 11 3 3 31 2-brompropan
  24. - Quy tắc Maccopnhicop: Trong phản ứng cộng HX vào liên kết đôi, nguyên tử H (phần mang điện dương) chủ yếu cộng vào nguyên tử C bậc thấp hơn (có nhiều H hơn), còn nguyên hay nhóm nguyên tử X (phần mang điện âm) cộng vào nguyên tử C bậc cao hơn (ít H hơn). b. Phản ứng trùng hợp: Điều kiện: Phân tử phải có liên kết đôi C=C. ơ TH (t0 , xt) - Ví dụ: nCH 2 =CH 2  ( CH2-CH2 )n Etilen Polietilen (P.E) c. Phản ứng oxi hóa: 3n t0 - Oxi hóa hoàn toàn: CnH2n + O2  nCO2 + nH2O (n =n ) 2 H2O CO2 - Oxi hóa không hoàn toàn: Anken có thể làm mất màu dung dịch B 2 và dung dịch thuốc tím. Phản ứng này dùng để nhận biết anken và hợp chất chứa liên kết . 4. Điều chế 0 H2SO4 , 170 C a. Phòng thí nghiệm: CnH2n+1OH  CnH2n + H2O t0 , p, xt b. Điều chế từ ankan: CnH2n+2  CnH2n + H2 II. ANKADIEN 1. Định nghĩa - Phân loại - Danh pháp a. Định nghĩa: Là hidrocacbon không no mạch hở, trong phân tử chứa hai liên kết C=C, có CTTQ CnH2n-2 (n 3 ) - Ví dụ: CH2=C=CH2, CH2=CH-CH=CH2 . . . b. Phân loại: Có ba loại: - Ankadien có hai liên kết đôi liên tiếp. - Ankadien có hai liên kết đôi cách nhau bởi một liên kết đơn (ankadien liên hợp). - Ankadien có hai liên kết đôi cách nhau từ hai liên kết đơn trở lên. c. Danh pháp: Số chỉ vị trí nhánh + tên nhánh + tên anka mạch C chính + số chỉ vị trí liên kết đôi + đien. CH2=CH-CH=CH2 (buta-1,3-đien) 2. Tính chất hóa học a. Phản ứng cộng (H2, X2, HX) Ni, t0 * Cộng H2: CH2=CH-CH=CH2 + 2H2  CH3-CH2-CH2-CH3 * Cộng brom: -800 C Cộng 1:2 CH2=CH-CH=CH2 + Br2 (dd)  CH2=CH-CHBr-CH2Br (spc) 400 C Cộng 1:4 CH2=CH-CH=CH2 + Br2 (dd)  CH2Br-CH=CH-CH2Br (spc) Cộng đồng thời vào hai liên kết đôi CH2=CH-CH=CH2 + 2Br2 (dd)  CH2Br-CHBr-CHBr-CH2Br * Cộng HX -800 C Cộng 1:2 CH2=CH-CH=CH2 + HBr  CH2=CH-CHBr-CH3 (spc) 400 C Cộng 1:4 CH2=CH-CH=CH2 + HBr  CH2=CH-CH2-CH2Br (spc) b. Phản ứng trùng hợp: p, xt, t0 - VD: nCH2=CH-CH=CH2  ( CH2-CH=CH-CH2 )n Cao su buna c. Phản ứng oxi hóa: - Oxi hóa hoàn toàn Tài liệu ôn tập Hóa Học 11 32
  25. t0 2C4H6 + 11O2  8CO2 + 6H2O - Oxi hóa không hoàn toàn: Tương tự như anken thì ankadien có thể làm mất màu dung dịch thuốc tím. Phản ứng này dùng để nhận biết ankadien. 3. Điều chế - Được điều chế từ ankan tương ứng bằng phản ứng tách H2. xt, t0 CH3CH2CH2CH3  CH2=CH-CH=CH2 + 2H2 xt, t0 CH3-CH(CH3)-CH2-CH3  CH2=C(CH3)-CH=CH2 + 2H2 III. ANKIN 1. Khái niệm - Đồng phân - Danh pháp a. Khái niệm - Là hidrocacbon không no mạch hở trong phân tử có một liên kết C  C , có CTTQ là CnH2n-2 (n 2). - Các chất C2H2, C3H4, C4H6 . . .CnH2n-2 (n 2) hợp thành một dãy đồng đẵng của axetilen. b. Đồng phân - Chỉ có đồng phân cấu tạo (đồng phân mạch C và đồng phân vị trí liên kết C  C ). Ankin không có đồng phân hình học. - Thí dụ: C4H6 có hai đồng phân CH≡C-CH2-CH3; CH3-C≡C-CH3. c. Danh pháp: - Danh pháp thường: Tên gốc ankyl + axetilen + VD: C2H2 (axetilen), CH≡C-CH3 (metylaxetilen) - Danh pháp thay thế: Số chỉ vị trí nhánh + tên nhánh + tên mạch C chính + số chỉ vị trí nối 3 + in 4 3 2 1 CH3 - CH2 - C  CH But-1-in 4 3 2 1 CH3 - C  C- CH3 But-2-in 2. Tính chất hóa học: a. Phản ứng cộng (H2, X2, HX, phản ứng đime hóa và trime hóa). - Thí dụ + Cộng H2 Ni, t0 CH≡CH + H2  CH2=CH2 Ni, t0 CH2=CH2 + H2  CH3-CH3 Nếu dùng xúc tác Pd/PbCO3 hoặc Pd/BaSO4, ankin chỉ cộng một phân tử H2 tạo anken 0 Pd/PbCO3 , t CH≡CH + H2  CH2=CH2 + Cộng X2 CH≡CH + Br2  CHBr =CHBr CHBr=CHBr + Br2  CHBr2-CHBr2 + Cộng HX CH≡CH + HCl HgCl2  CH =CHCl 150-2000 C 2 + Phản ứng đime hóa - trime hóa xt, t0 2CH≡CH  CH2=CH-C≡CH (vinyl axetilen) 6000 C 3CH≡CH xt  C6H6 b. Phản ứng thế bằng ion kim loại: - Điều kiện: Phải có liên kết 3 ở đầu mạch. R-C≡CH + AgNO3 + NH3 → R-C≡CAg↓ + NH4NO3 Tài liệu ôn tập Hóa Học 11 33
  26. Phản ứng này dùng để nhận biết Ank-1-in c. Phản ứng oxi hóa: - Oxi hóa hoàn toàn: 3n -1 CnH2n-2 + O2 → nCO2 + (n-1)H2O (n > n ) 2 CO2 H2O - Oxi hóa không hoàn toàn: Tương tự như anken và ankadien, ankin cũng có khả năng làm mất màu dung dịch thuốc tím. Phản ứng này dùng để nhận biết ankin. 3. Điều chế: a. Phòng thí nghiệm: CaC2 + 2H2O → C2H2↑ + Ca(OH)2 15000 C b. Trong công nghiệp: 2CH4  C2H2 + 3H2 IV. BENZEN VÀ DÃY ĐỒNG ĐẴNG: 1. Đồng đẵng - Đồng phân - Danh pháp: a. Đồng đẵng: Dãy đồng đẵng của benzen có CTTQ là CnH2n-6. b. Đồng phân: Đồng phân về vị trí tương đối của các nhóm ankyl xung quanh vòng benzen (o, m, p). - Ví dụ: C8H10 C2H5 CH3 CH3 CH3 CH3 CH3 CH c. Danh pháp: Gọi tên theo danh pháp hệ thống. 3 Số chỉ vị trí nhóm ankyl + tên ankyl + benzen. - VD: C6H5CH3 (metylbenzen). 2. Tính chât hóa học: a. Phản ứng thế: * Thế nguyên tử H ở vòng benzen - Tác dụng với halogen Br bột Fe + Br2 + HBr Cho ankyl benzen phản ứng với brom có bột sắt thì thu được hỗn hợp sản phẩm thế brom chủ yếu vào vị trí ortho và para. - VD: CH3 CH3 bét Fe -Br + Br2  + HBr o-bromtoluen CH3 + HBr Br p-bromtoluen - Phản ứng giữa benzen và đồng đẳng với axit HNO3 xãy ra tương tự như phản ứng với halogen. - Quy tắc thế H ở vòng benzen: Các ankyl benzen dể tham gia phản ứng thế nguyên tử H của vòng benzen hơn benzen và sự thế ưu tiên ở vị trí ortho và para so với nhóm ankyl. Tài liệu ôn tập Hóa Học 11 34
  27. * Thế nguyên tử H ở mạch chính t0 - C6H5CH3 + Br2  C6H5CH2Br + HBr b. Phản ứng cộng: - Cộng H2 và cộng Cl2. c. Phản ứng oxi hóa: - Oxi hóa không hoàn toàn: Toluen có khả năng làm mất màu dung dịch thuốc tím còn benzen thì không. Phản ứng này dùng để nhận biết Toluen. - Phản ứng oxi hóa hoàn toàn: 3n -3 CnH2n-6 + O2 → nCO2 + (n-3)H2O 2 V. STIREN: 1. Cấu tạo: CTPT: C8H8; CTCT: CH=CH2 2. Tính chất hóa học: a. Phản ứng với dung dịch Br2. Phản ứng này dùng để nhận biết stiren. b. Phản ứng với H2. c. Tham gia phản ứng trùng hợp ở liên kết đôi C=C. VI. NAPTTALEN: 1. Câu tạo phân tử: - CTPT: C10H8. CTCT: 2. Tính chất hóa học: - Tham gia phản ứng thế và tham gia phản ứng cộng. B. BÀI TẬP CÓ HƯỚNG DẪN GIẢI 1. Lập CTPT của anken CTPT của anken là: CnH2n. Để lập CTPT của anken ta có thể sử dụng một trong các cách sau (tùy bài ra mà ta sẽ có các cách giải phù hợp): * Cách 1: M = 14n. M ta có thể tính bằng nhiều cách khác nhau tùy vào dử kiện bài ra. n * Cách 2: n = CO2 . nanken * Cách 3: Ta lập tỉ lệ trên PTHH để đưa ra phương trình bậc nhất một ẩn (ẩn đó là n). Từ đó tính giái trị n. * Lưu ý: Nếu là hỗn hợp hai anken đồng đẵng kế tiếp của nhau thì ta quy thành một anken có CT là C nH2n . Từ đó tính giá trị n . 2. Lập CTPT của ankin CTPT của ankin là: CnH2n-2. Để lập CTPT của ankin ta có thể sử dụng một trong các cách sau (tùy bài ra mà ta sẽ có các cách giải phù hợp): * Cách 1: M = 14n - 2. M ta có thể tính bằng nhiều cách khác nhau tùy vào dử kiện bài ra. n n n * Cách 2: n = CO2 ; n = n - n n = CO2 = CO2 n ankin CO2 H2O n n n ankin ankin CO 2 H2O * Cách 3: Ta lập tỉ lệ trên PTHH để đưa ra phương trình bậc nhất một ẩn (ẩn đó là n). Từ đó tính giái trị n. * Lưu ý: Nếu là hỗn hợp hai ankin đồng đẵng kế tiếp của nhau thì ta quy thành một ankin có CT là C nH2n 2 . Từ đó tính giá trị n . Ví dụ 1: Đốt cháy hoàn toàn 2,24 lít hidrocacbon X thu được 6,72 lít khí CO2 (các thể tích khí được đo ở đktc). X tác dụng với AgNO3 trong NH3 sinh ra kết tủa Y. Xác định CTCT của X. Tài liệu ôn tập Hóa Học 11 35
  28. Giải Do X tác dụng với AgNO3 trong NH3 sinh ra kết tủa Y từ đó ta có thể suy ra X là Ankin. Đặt CTPT của X là: CnH2n-2. 2.24 6.72 n = = 0.1 (mol); n = = 0.3 (mol) X 22.4 CO2 22.4 n CO2 0.3 n = = = 3 CTPT của X là C3H4. CTCT của X là: CH≡C-CH3 nankin 0.1 Ví dụ 2: Đốt cháy hoàn toàn 6.72 lít hỗn hợp X gồm hai anken là đồng đẳng kế tiếp nhau cần 26.88 lít khí oxi. Xác định công thức của hai anken. Giải Đặt CTPT của 2 anken là C nH2n . 6.72 26.88 n = = 0.3 (mol); n = = 1.2 (mol) anken 22.4 O2 22.4 3n C H + O2 n CO2 +n H2O n 2n 2 0.3 1.2 3n 1.2 = 0.3* n = 2.67. Vậy CT của hai anken là: C2H4 và C3H6. 2 C. PHẦN BÀI TẬP CƠ BẢN Câu 1. Viết CTCT các đồng phân (cấu tạo) anken ứng với CTPT là C 4H8 và C5H10 và gọi tên theo tên thay thế. Câu 2. Viết CTCT các anken có tên gọi sau: a. Butilen, 2-metylbut-2-en, pent-1-en, 2,3-đimetylpent-2-en. b. Propilen, hex-1-en, etilen, 2-metylpent-1-en, iso-butilen. Câu 3. Gọi tên các anken sau theo danh pháp thay thế a. CH2=CH-CH2-CH3, CH2=C(CH3)-CH2-CH3, CH3-C(CH3)=C(CH3)-CH2-CH3. b. CH3-CH=CH-CH(CH3)-CH2-CH3, CH2=CH-CH3, CH2=CH2. Câu 4. Hoàn thành các PTHH của các phản ứng sau: Ni, t0 a. CH3-CH=CH-CH3 + H2  b. CH2=CH-CH3 + Br2 c. CH2=C(CH3)-CH3 + HBr H d. CH2=CH-CH2-CH3 + H2O  e. CH3-CH=CH-CH3 + HBr t0 f. C2H4 + O2  p, xt, t0 g. nCH2=CH2  p, xt, t0 h. nCH2=CH-CH3  p, xt, t0 i. nCH2=CHCl  Câu 5. Viết PTHH điều chế các chất sau đi từ các chất hữu cơ tương ứng. PE, PVC, etilen, propilen, 2-clopropan, ancol etylic. Câu 6 (A-08). Cho các chất sau: CH2=CH-CH2-CH2-CH=CH2, CH2=CH-CH=CH-CH2-CH3, CH3- C(CH3)=CH-CH3, CH2=CH-CH2-CH=CH2. Chất nào có đồng phân hình học. Viết CTCT các đồng phân cis-trans của nó. Câu 7. Viết CTCT các đồng phân ankin ứng với CTPT là C4H6 và C5H8 và gọi tên theo tên thay thế. Câu 8. Viết CTCT các ankin có tên gọi sau: a. Metyl axetilen, etyl metyl axetilen, đimetyl axetilen, 3-metylbut-1-in, pent-1-in. Tài liệu ôn tập Hóa Học 11 36
  29. b. Hex-2-in, axetilen, 3,4-đimetylpent-1-in. Câu 9. Gọi tên các anken sau theo danh pháp thay thế a. CH≡CH-CH2-CH3, CH≡C-CH(CH3)-CH3, CH3-C(CH3)=C(CH3)-CH2-CH3. b. CH3-C≡C-CH(CH3)-CH2-CH3, CH≡CH-CH3, CH≡CH. Câu 10. Hoàn thành các PTHH của các phản ứng sau: Ni, t0 a. CH≡C-CH3 + H2  0 Pd, PbCO3 , t b. CH≡C-CH3 + H2  c. CH≡C-CH3 + Br2 d. CH≡CH + HCl 1 mol 1 mol Hg2 e. CH≡CH + H2O  f. 2CH≡CH xt (®ime hãa) 0 g. 3CH≡CH 600 C, xt (trime hãa) Câu 11. Viết PTHH điều chế các chất sau từ các mono me tương ứng. Axetilen, vinyl clorua, benzen, vinyl axetilen. Câu 12. Hoàn thành các chuổi phản ứng sau: a. CH4  C2H2  C2H4  C2H6  C2H5Cl  C2H4. b. CH4  C2H2  C4H4  C4H6  polibutadien c. CH4  C2H2  C6H6  C6H5Br d. C2H6  C2H4  PE e. CH4  C2H2  Vinyl clorua  PVC Câu 13. Nhận biết các chất sau bằng phương pháp hóa học. a. CH4, C2H4, C2H2 và CO2. b. But-1-in và but-2-in c. Benzen, hex-1-en và toluen d. Benzen, stiren và toluen Câu 14. Từ CH4 và các hóa chất vô cơ cần thiết khác, hãy viết các PTHH điều chế: Cao su buna, benzen, PE và PVC. Câu 15. Viết CTCT các đồng phân benzen ứng với CTPT C8H10 và gọi tên các đồng phân đó. Câu 16. Hoàn thành các PTHH của các phản ứng sau: t0 a. C6H5CH3 + Br2  Fe, t0 b. C6H5CH3 + Br2  0 H2SO4 (®Æc), t c. C6H5CH3 + HNO3(đặc)  d. C6H5CH=CH2 + Br2 e. C6H5CH=CH2 + HBr p, xt, t0 e. nC6H5CH=CH2  Câu 17. Đốt cháy hoàn toàn 3.36 lít hồn hợp khí etilen và propilen thu được 8.96 lít khí CO 2 và m gam nước (các khí đều được đo ở đktc). a. Tính % thể tích mỗi khí trong hỗn hợp đầu. b. Tính giá trị m. Câu 18. Đốt cháy hoàn toàn hỗn hợp khí C 3H6 và C4H8. Toàn bộ sản phẩm cháy thu được dẫn qua bình 1 đựng H2SO4 (đặc), bình 2 đựng dung dịch nước vôi trong dư. Thấy khối lượng bình 1 tăng 9 gam, bình 2 tăng m gam. Tính giá trị m. Câu 19. Đốt cháy hoàn toàn 2.24 lít hỗn hợp khí propilen và butilen. Toàn bộ sản phẩm cháy thu được sục qua bình đựng dung dịch nước vôi trong dư thu được 25 gam kết tủa và thấy khối lượng bình tăng lên m gam. a. Tính thể tích mỗi khí trong hỗn hợp đầu. b. Tính giá trị m. Tài liệu ôn tập Hóa Học 11 37
  30. Câu 20. Dẫn từ từ 3,36 lít hỗn hợp khí etilen và propilen (đktc) vào dung dịch brom thấy dung dịch bị nhạt màu và không có khí thoát ra. Khối lượng dung dịch sau phản ứng tăng 4,9 gam. a. Viết các PTHH và giải thích các hiện tượng ở thí nghiệm trên. b. Tính % theo thể tích của mỗi khí trong hỗn hợp ban đầu. Câu 21. Dẫn từ từ 4,48 lít hỗn hợp khí etilen và propilen (đktc) vào dung dịch brom dư thấy có 80 gam brom phản ứng. a. Viết các PTHH và giải thích các hiện tượng ở thí nghiệm trên. b. Tính thể tích của mỗi khí trong hỗn hợp ban đầu. Câu 22. Đốt cháy hoàn toàn 0.672 lít hỗn hợp khí etilen và propilen cần 2.688 lít khí oxi. Toàn bộ sản phẩm cháy thu được sục vào dung dịch nước vôi trong dư thu được m gam kết tủa. a. Tính % thể tích mỗi khí trong hỗn hợp đầu. b. Tính giá trị m. Câu 23. Đốt cháy hoàn toàn 4.48 lít hỗn hợp hai anken X (đktc) là đồng đẳng kế tiếp của nhau thu được 11.2 lít khí CO2 (đktc). a. Xác định công thức của hai anken. b. Tính % thể tích mỗi anken trong hỗn hợp ban đầu. Câu 24. Đốt cháy hoàn toàn 6.72 lít hỗn hợp X gồm hai anken là đồng đẳng kế tiếp nhau cần 26.88 lít khí oxi. a. Xác định công thức của hai anken. b. Cho hỗn hợp X qua dung dịch brom dư, tính khối lượng brom đã tham gia phản ứng. Câu 25. Oxi hóa hoàn toàn 0,68 gam ankadien X thu được 1,12 lít CO2 (đktc). a. Tìm công thức phân tử của X. b. Viết CTCT có thể có của X. Câu 26. Cho 4,48 lít hỗn hợp khí gồm metan và etilen đi qua dung dịch brom dư, thấy dung dịch bị nhạt màu và có 1,12 lít khí thoát ra. Các thể tích khí đo ở điều kiện tiêu chuẩn. Tính % theo thể tích mỗi khí trong hỗn hợp ban đầu. Câu 27. Dẫn 3,36 lít hỗn hợp A gồm propin và etilen đi vào một lượng dư dung dịch AgNO 3 trong NH3 thấy còn 0,84 lít khí thoát ra và có m gam kết tủa. Các thể tích khí được đo ở điều kiện tiêu chuẩn. a. Tính % theo thể tích etilen trong A. b. Tính m. Câu 28. Dẫn 6,72 lít hỗn hợp khí X gồm propan, etilen và axetilen qua dung dịch brom dư, thấy còn 1,68 lít khí không bị hấp thụ. Nếu dẫn 6,72 lít khí X trên qua dung dịch AgNO 3 trong NH3 thấy có 24,24 gam kết tủa. Các thể tích khí đo ở điều kiện tiêu chuẩn. a. Viết PTHH của các phản ứng xãy ra. b. Tính % theo thể tích và theo khối lượng mỗi khí trong hỗn hợp ban đầu. Câu 29. Đốt cháy hoàn toàn 2,24 lít hidrocacbon X thu được 6,72 lít khí CO2 (các thể tích khí được đo ở đktc). X tác dụng với AgNO3 trong NH3 sinh ra kết tủa Y. Xác định CTCT của X. Câu 30. Hidrocacbon X là chất lỏng có tỉ khối hơi so với không khí là 3,17. Đốt cháy hoàn toàn X thu được CO2 có khối lượng bằng 4,28 lần khối lượng H 2O. Ở nhiệt độ thường X không làm mất màu dung dịch brom. Khi đun nóng X làm mất màu dung dịch KMnO 4. Tìm CTPT và viết CTCT của X. Câu 31. Cho benzen tác dụng với lượng dư HNO3 đặc có xúc tác H2SO4 đặc để điều chế nitrobenzen. Tính khối lượng nitrobenzen thu được khi dùng 1 tấn benzen với hiệu suất 78%. Câu 32. Trùng hợp 5,6 lít C2H4 (đktc) nếu hiệu suất phản ứng đạt 90% thì khối lượng polime thu được là bao nhiêu? Câu 33. Đốt cháy hoàn toàn 4,48 lít C3H6 ( đktc) rồi cho sản phẩm cháy đi qua bình đựng dung dịch nước vôi trong có dư thấy khối lượng bình tăng m(g). Xác định giá trị của m. Tài liệu ôn tập Hóa Học 11 38
  31. Câu 34. Hỗn hợp X gồm C2H4 và C2H2. Dẫn 1,12 lít hỗn hợp X đi qua bình đựng dung dịch AgNO3/NH3 thu được 2,4 g kết tủa vàng. Xác định thể tích của C 2H4 và C2H2 đo được ở điều kiện chuẩn? Câu 35. Đốt cháy hoàn toàn 4,48 lít hỗn hợp khí C 2H4 và C3H6 (đktc) thu được 11,2 lít khí CO 2 (đktc). a. Xác định % theo thể tích mỗi khí trong hỗn hợp đầu. b. Tính khối lượng nước sinh ra. Câu 36. Một hỗn hợp gồm hai anken có thể tích 11,2 lít (đktc) kế tiếp nhau trong dãy đồng đẳng. Khi cho hổn hợp đi qua dung dịch brom thì thấy khối lượng bình brom tăng lên 15,4 g. a. Xác định CTPT của hai anken. b. Tính thể tích mỗi khí trong hỗn hợp ban đầu. Câu 37. Cho (A) và (B) là 2 anken đồng đẳng kế tiếp nhau. Cho 13,44 lít (đktc) hỗn hợp 2 anken (A) và (B) qua bình đựng dung dịch Br2 thấy bình Br2 tăng lên 28 gam. a. Xác định CTPT của A, B. b. Cho hỗn hợp 2 anken + HCl thu được 3 sản phẩm. Hãy cho biết CTCT của (A) và (B). Câu 38. Dẫn 4,48 lít hỗn hợp gồm C 2H4 và C3H4 (đktc) qua bình đựng dung dịch Br 2 dư thấy khối lượng bình tăng 6,2 gam. Tính phần trăm thể tích của C3H4 trong hỗn hợp. Câu 39. Cho 12,60 gam hỗn hợp 2 anken là đồng đẳng kế tiếp tác dụng vừa đủ với dung dịch Br 2 thu được 44,60 gam hỗn hợp sản phẩm. Xác định công thức phân tử của 2 anken. Câu 40. Chia 16,4 gam hỗn hợp gồm C2H4 và C3H4 thành 2 phần bằng nhau. Phần 1 tác dụng vừa đủ 0 với dung dịch chứa 56,0 gam Br2. Phần 2 cho tác dụng hết với H 2 (Ni, t ), rồi lấy 2 ankan tạo thành đem đốt cháy hoàn toàn thì thu được x gam CO2. Tính giá trị của x. Câu 41. Đốt cháy hoàn toàn 0,2 mol hỗn hợp 2 ankin là đồng đẳng kế tiếp thu được 9,0 gam nước. Xác định công thức phân tử của 2 ankin. Câu 42. Đốt cháy hoàn toàn hỗn hợp 2 anken thu được 11,2 lít khí CO 2 (đktc). Tính thể tích khí O2 (đktc) đã tham gia phản ứng cháy. Câu 43. Đốt cháy hoàn toàn hỗn hợp 3 anken rồi dẫn sản phẩm cháy lần lượt qua bình 1 đựng dung dịch H2SO4 đặc và bình 2 đựng dung dịch nước vôi trong dư, thấy khối lượng bình 1 tăng m gam và khối lượng bình 2 tăng (m + 5,2) gam. Tính giá trị của m. Câu 44. Khi cho 0,2 mol một ankin tác dụng với AgNO 3 trong dung dịch NH3 (dư) thu được 29,4 gam kết tủa. Xác định công thức phân tử của ankin. D. PHẦN BÀI TẬP NÂNG CAO Câu 1 (A-07). Ba hiđrocacbon X, Y, Z kế tiếp nhau trong dãy đồng đẳng, trong đó khối lượng phân tử Z gấp đôi khối lượng phân tử X. Đốt cháy 0,1 mol chất Y, sản phẩm khí hấp thụ hoàn toàn vào dung dịch Ca(OH)2 dư, thu được m gam kết tủa. Tính m. Câu 2 (B-2008). Đốt cháy hoàn toàn 1 lít hỗn hợp khí gồm C 2H2 và hiđrocacbon X sinh ra 2 lít khí CO2 và 2 lít hơi H2O (các thể tích khí và hơi đo ở cùng điều kiện nhiệt độ, áp suất). Xác định công thức phân tử của X. Câu 3 (B-2010). Hỗn hợp khí X gồm một ankan và một anken. Tỉ khối của X so với H 2 bằng 11,25. Đốt cháy hoàn toàn 4,48 lít X, thu được 6,72 lít CO 2 (các thể tích khí đo ở đktc). Xác định công thức của ankan và anken. Câu 4 (A-07). Cho 4,48 lít hỗn hợp X (đktc) gồm 2 hiđrocacbon mạch hở lội từ từ qua bình chứa 1,4 lít dung dịch Br2 0,5M. Sau khi phản ứng xảy ra hoàn toàn, số mol Br2 giảm đi một nửa và khối lượng bình tăng thêm 6,7 gam. Xác định công thức phân tử của 2 hiđrocacbon. Câu 5 (B-08). Dẫn 1,68 lít hỗn hợp khí X gồm hai hiđrocacbon vào bình đựng dung dịch brom (dư). Sau khi phản ứng xảy ra hoàn toàn, có 4 gam brom đã phản ứng và còn lại 1,12 lít khí. Nếu đốt cháy hoàn toàn 1,68 lít X thì sinh ra 2,8 lít khí CO2. Xác định công thức phân tử của hai hiđrocacbon (biết các thể tích khí đều đo ở đktc). Tài liệu ôn tập Hóa Học 11 39
  32. Câu 6 (A-2010). Đun nóng hỗn hợp khí X gồm 0,02 mol C 2H2 và 0,03 mol H2 trong một bình kín (xúc tác Ni), thu được hỗn hợp khí Y. Cho Y lội từ từ vào bình nước brom (dư), sau khi kết thúc các phản ứng, khối lượng bình tăng m gam và có 280 ml hỗn hợp khí Z (đktc) thoát ra. Tỉ khối của Z so với H2 là 10,08. Tính giá trị của m. Câu 7 (B-09). Hỗn hợp khí X gồm H 2 và một anken có khả năng cộng HBr cho sản phẩm hữu cơ duy nhất. Tỉ khối của X so với H 2 bằng 9,1. Đun nóng X có xúc tác Ni, sau khi phản ứng xảy ra hoàn toàn, thu được hỗn hợp khí Y không làm mất màu nước brom; tỉ khối của Y so với H 2 bằng 13. Xác định công thức cấu tạo của anken. Câu 8 (CĐ-09). Hỗn hợp khí X gồm H 2 và C2H4 có tỉ khối so với He là 3,75. Dẫn X qua Ni nung nóng, thu được hỗn hợp khí Y có tỉ khối so với He là 5. Tính hiệu suất của phản ứng hiđro hoá. 0 Câu 9 (CĐ-2010). Cho 3,12 gam ankin X phản ứng với 0,1 mol H2 (xúc tác Pd/PbCO3, t ), thu được hỗn hợp Y chỉ có hai hiđrocacbon. Xác định công thức phân tử của X. Câu 10. Hỗn hợp X gồm một olefin M và H 2 có khối lượng phân tử trung bình 10.67 đi qua Ni đun nóng thu được hỗn hợp khí Y có tỉ khối so với H 2 là 18. Biết M phản ứng hết. Xác định CTPT của M. 0 Câu 11 (CĐ-2010). Cho 3,12 gam ankin X phản ứng với 0,1 mol H 2 (xúc tác Pd/PbCO3, t ), thu được hỗn hợp Y chỉ có hai hiđrocacbon. Xác định công thức phân tử của X. CHUYÊN ĐỀ VII DẪN XUẤT HALOGEN - ANCOl - PHENOl A. PHẦN LÝ THUYẾT I. DẪN XUẤT HALOGEN CỦA HIDROCACBON 1. Khái niệm - Khi thay thế nguyên tử hidro của phân tử hidrocacbon bằng nguyên tử halogen ta được dẫn xuất halogen có CTTQ: RCl + Ví dụ: CH3Cl, C6H5Cl - Bậc của dẫn xuất halogen: Chính là bậc của nguyên tử C liên kết trực tiếp với C. + Ví dụ: Bậc I: CH3CH2Cl (etyl clorua) Bậc II: CH3CHClCH3 (isopropyl clorua) Bậc III: (CH3)C-Br (tert - butyl bromua) 2. Tính chất hóa học: a. Phản ứng thế nguyên tử halogen bằng nhóm OH: 0 RX + NaOH t ROH + NaX t0 CH3CH2Br + NaOH  CH3CH2OH + NaBr b. Phản ứng tách hidro halogenua: - CH -CH Cl + KOH C2H5OH CH =CH + KCl + H O 3 2 t0 2 2 2 - PTTQ: (đối với dẫn xuất halogen no, đơn chức, mạch hở) C H X + KOH C2H5OH C H + KX + H O n 2n+1 t0 n 2n 2 - Quy tắc Zaixep: Nguyên tử X tách với nguyên tử H ở C bậc cao hơn. II. ANCOL 1. Định nghĩa - Phân loại a. Định nghĩa - Ancol là những hợp chất hữu cơ trong phân tử có nhóm OH liên kết trực tiếp với nguyên tử C no. Ví dụ: C2H5OH - Bậc ancol là bậc của nguyên tử C liên kết trực tiếp với nhóm OH. Thí dụ Tài liệu ôn tập Hóa Học 11 40
  33. CH3-CH2-CH2-CH2OH: ancol bậc I CH3-CH2-CH(CH3)-OH: ancol bậc II CH3-C(CH3)2-OH: ancol bậc III b. Phân loại - Ancol no, đơn chức, mạch hở (CnH2n+1OH): Ví dụ: CH3OH . . . - Ancol không no, đơn chức mạch hở: CH2=CH-CH2OH - Ancol thơm đơn chức: C6H5CH2OH - Ancol vòng no, đơn chức: -OH xiclohexanol - Ancol đa chức: CH2OH-CH2OH (etilen glicol), CH2OH-CHOH-CH2OH (glixerol) 2. Đồng phân - Danh pháp a. Đồng phân: Chỉ có đồng phân cấu tạo (gồm đồng phân mạch C và đồng phân vị trí nhóm OH). - Thí dụ C4H10O có 4 đồng phân ancol CH3-CH2-CH2-CH2OH; CH3-CH(CH3)-CH2OH CH3-CH2-CH(CH3)-OH; CH3-C(CH3)2-OH b. Danh pháp: - Danh pháp thường: Ancol + tên gốc ankyl + ic + Ví dụ: C2H5OH (ancol etylic) - Danh pháp thay thế: Tên hidrocacbon tương ứng với mạch chính + số chỉ vị trí nhóm OH + ol 4 3 2 1 + Ví dụ: CH3 CH(CH3 )CH2 CH2OH (3-metylbutan-1-ol) 3. Tính chất vật lý - Tan nhiều trong nước do tạo được liên kết H với nước. Độ tan trong nước giảm dần khi số nguyên tử C tăng lên. 4. Tính chất hóa học a. Phản ứng thế H của nhóm OH * Tính chất cung của ancol 2C2H5OH + 2Na → 2C2H5ONa + H2↑ * Tính chất đặc trưng của ancol đa chức có hai nhóm OH liền kề - Hòa tan được Cu(OH)2 ở điều kiện thường tạo thành dung dịch màu xanh lam. Phản ứng này dùng để nhận biết ancol đa chức có hai nhóm OH liền kề. 2C3H5(OH)3 + Cu(OH)2 → [C3H5(OH)2O]2Cu + 2H2O b. Phản ứng thế nhóm OH * Phản ứng với axit vô cơ t0 C2H5 - OH + H - Br  C2H5Br + H2O * Phản ứng với ancol 0 H2SO4 , 140 C 2C2H5OH  C2H5OC2H5 + H2O đietyl ete 0 H2SO4 , 140 C - PTTQ: 2ROH  R-O-R + H2O c. Phản ứng tách nước 0 H2SO4 , 170 C C2H5OH  C2H4 + H2O 0 H2SO4 , 170 C - PTTQ: CnH2n+1OH  CnH2n + H2O d. Phản ứng oxi hóa: - Oxi hóa không hoàn toàn: + Ancol bậc 1 khi bị oxi hóa bởi CuO/to cho ra sản phẩm là andehit t0 RCH2OH + CuO  RCHO + Cu↓ + H2O + Ancol bậc hai khi bị oxi hóa bởi CuO/to cho ra sản phẩm là xeton. Tài liệu ôn tập Hóa Học 11 41
  34. t0 R-CH(OH)-R’ + CuO  R-CO-R’ + Cu↓ + H2O + Ancol bậc III khó bị oxi hóa. - Oxi hóa hoàn toàn: 3n t0 CnH2n+1OH + O2  nCO2 + (n+1)H2O 2 5. Điều chế: a. Phương pháp tổng hợp: 0 H2SO4 , t - Điều chế từ anken tương ứng: CnH2n + H2O  CnH2n+1OH - Điều chế Glixerol đi từ anken tương ứng là CH2=CH-CH3. b. Phương pháp sinh hóa: Điều chế C2H5OH từ tinh bột. (C H O ) +H2O C H O 6 10 5 n t0 , xt 6 12 6 enzim C6H12O6  2C2H5OH + 2CO2 II. PHENOL 1. Định nghĩa - Phân loại - Danh pháp a. Định nghĩa: Phenol là những hợp chất hữu cơ trong phân tử có nhóm -OH liên kết trực tiếp với nguyên tử C vòng benzen. - Ví dụ: C6H5OH (phenol) . . . b. Phân loại: - Phenol đơn chức: Phân tử có một nhóm -OH phenol. - Phenol đa chức: Phân tử chứa hai hay nhiều nhóm -OH phenol. c. Danh pháp: Số chỉ vị trí nhóm thế + phenol 2. Tính chất hóa học: a. Phản ứng thế nguyên tử H của nhóm OH - Tác dụng với kim loại kiềm 2C6H5OH + 2Na → 2C6H5ONa + H2↑ - Tác dụng với dung dịch bazơ C6H5OH + NaOH → C6H5ONa + H2O b. Phản ứng thế H của vòng benzen: Tác dụng với dung dịch Brom (Phản ứng này dùng để nhận biết phenol). C6H5OH + 3Br2 → C6H2Br3OH↓ + 3HBr 3. Điều chế: Để điều chế phenol ta có sơ đồ sau: C6H6 → C6H5Br → C6H5ONa → C6H5OH B. BÀI TẬP CÓ HƯỚNG DẪN GIẢI 1. Lập CTPT của ancol * CT của ancol no đa chức: CnH2n+2-a(OH)a hoặc CnH2n+2Oa. * CT của ancol no đơn chức: CnH2n+1OH. Để lập công thức phân tử của ancol chúng ta có thể sử dụng một trong các cách sau (Ở đây ta chỉ xét ancol no): * Cách 1: M = 14n + 18 (đơn chức) hoặc M = 14n + 2 + 16a. M ta có thể tính bằng nhiều cách khác nhau tùy vào dử kiện bài ra. nCO * Cách 2: n = 2 . Lưu ý: Công thức này ta có thể áp dụng cho mọi dãy đồng đẵng mà ta sẽ gặp nancol n n sau này. n = n - n n = CO2 = CO2 ancol H2O CO2 n n n ancol H2O CO 2 * Cách 3: Ta lập tỉ lệ trên PTHH để đưa ra phương trình bậc nhất. Từ đó tính giái trị n. Tài liệu ôn tập Hóa Học 11 42
  35. * Lưu ý: Nếu là hỗn hợp hai ancol đồng đẵng kế tiếp của nhau thì ta quy thành một ancol có CT là C nH2n 2Oa . Từ đó tính giá trị n . Ví dụ 1: Đốt cháy hoàn toàn một ancol đơn chức X thu được 4,4 gam CO 2 và 3,6 gam H2O. Xác định công thức phân tử của X. Giải Đặt CTPT của X là CnH2n+1OH. 4.4 3.6 n = = 0.1 (mol); n = 0.2 (mol) CO2 44 H2O 18 n n CO2 CO2 0.1 n = = = = 1. Từ đó suy ra CTPT của ancol là: CH3OH. n n n 0.2 0.1 ancol H2O CO 2 2. Bài tập tách nước của ancol tạo ete Đối với phần bài tập này, ancol tách nước tạo ete thường là ancol no đơn chức. Do vậy ta chỉ xét đối với ancol no đơn chức. 2ROH ROR + H2O m = m + m và n = 2n ancol ete H2O ancol H2O * Lưu ý: - Đối với phần này đa số ta vận dụng định luật bảo toàn khối lượng để giải bài tập. - Nếu đề bài cho hỗn hợp nhiều ancol thì ta quy về một ancol để giải và cách giải ta xem như là một ancol với PTHH như sau 2ROH ROR H2O Ví dụ 2: Đun nóng 12,90 gam hỗn hợp X gồm 2 ancol no, đơn chức, bậc 1, là đồng đẳng kế tiếp o trong H2SO4 đặc ở 140 C thu được 10,65 gam hỗn hợp Y gồm 3 ete (h = 100%). Xác định công thức phân tử của hai ancol. Giải Đặt CT của hai ancol là 2ROH . 2.25 m = m - m = 12.9 - 10.65 = 2.25 (gam) n = = 0.125 (mol) H2O ancol ete H2O 18 m 12.9 n = 2n = 0.25 (mol) M = = = 51.6 ancol H2O ROH n 0.25 R + 17 = 51.6 R = 34.6 . Vậy công thức phân tử hai ancol là: C2H5OH và C3H7OH 3. Bài tập về oxi hóa ancol bậc 1 và 2 Ta chỉ xét ancol no đơn chức t0 CnH2n+1OH + CuO CnH2n O + Cu + H2O nO (CuO) = nancol = nandehit hoÆc xeton = nCu C. PHẦN BÀI TẬP CƠ BẢN Câu 1. Viết CTCT các đồng phân ancol ứng với CTPT C 3H8O, C4H10O, C5H12O và gọi tên theo danh pháp thay thế. Câu 2. Viết CTCT các ancol có tên gọi sau: a. Ancol iso-propylic, ancol etylic, ancol n-propylic, etanol, propan-1-ol. b. 3-metylbutan-1-ol, 2-metylbutan-2-ol, pentan-1-ol, 2-metylpropan-2-ol. Câu 3. Gọi tên các ancol sau theo danh pháp thay thế. a. CH3-CH(OH)-CH2-CH3; CH3-CH2-CH2-CH2OH; CH3-C(CH3)2-CH2-CH(OH)-CH3. b. CH3-CH2-CH(CH3)-OH; CH3OH, CH3-CH=CH-CH(CH3)-CH2OH Tài liệu ôn tập Hóa Học 11 43
  36. Câu 4. Hoàn thành các PTHH của các phản ứng sau: t0 a. CH3Cl + NaOH  t0 b. CH3-CH2-CH2Cl + KOH  0 C2H5OH, t c. CH3-CH2-CH2Cl + KOH  0 C2H5OH, t d. CH3-CHCl-CH2CH3 + NaOH  Câu 5. Hoàn thành các PTHH của các phản ứng sau: a. CH3OH + Na b. C3H5(OH)3 + Na c. ROH + HCl 0 H2SO4 , 140 C d. C2H5OH  0 H2SO4 , 170 C e. C2H5OH  0 H2SO4 , 170 C f. CH3-CH(OH)-CH2-CH3  t0 g. C2H5OH + CuO  t0 h. iso-C3H7OH + CuO  t0 i. n-C3H7OH + CuO  t0 k. C2H5OH + O2  t0 l. CnH2n+1OH + O2  Câu 6. Hoàn thành các PTHH của các phản ứng sau: a. C6H5OH + Na b. C6H5OH + KOH c. C6H5OH + Br2 0 H2SO4 (®Æc), t d. C6H5OH + HNO3 (đặc)  Câu 7. Viết PTHH để điều chế các chất sau từ các chất hữu cơ tương ứng: Etanol, etilen, propan-2-ol, propilen Câu 8. Hoàn thành các chuối phản ứng sau: a. Metan  axetilen  etilen  etanol  axit axetic b. Benzen  brombenzen  natri phenolat  phenol  2,4,6-tribromphenol Câu 9. Nhận biết các chất sau bằng phương pháp hóa học: a. Etanol, glixerol, nước và benzen. b. Phenol, etanol, glixerol, nước. c. Propan-1,2-điol; propan-1,3-điol. d. Propan-1,2,3-triol; propan-1,3-điol; 2-metylpropan-2-ol. Câu 10. Từ axetilen, viết PTHH của các phản ứng điều chế: etyl bromua (1); 1,2-đibrometan (2); vinyl clorua (3). Câu 11. Từ propen và các hóa chất vô cơ cần thiết khác có thể điều chế được các chất sau: propan- 2-ol (1); propan-1,2-điol (2). Viết PTHH của các phản ứng xãy ra. Câu 12. Từ benzen và các hóa chất vô cơ cần thiết khác có thể điều chế được các chất sau: 2,4,6- tribromphenol (1); 2,4,6-trinitrophenol (2). Viết PTHH của các phản ứng xãy ra. Câu 13. Cho 12,2 gam hỗn hợp X gồm etanol và propan-1-ol tác dụng với Na dư thu được 2,8 lít khí (đktc). a. Tính thành phần % khối lượng của mỗi chất trong hỗn hợp ban đầu. b. Cho hỗn hợp X qua ống đựng CuO đun nóng. Viết PTHH của các phản ứng xãy ra. Câu 14. Đốt cháy hoàn toàn 5,5 gam hỗn hợp X gồm hai ancol CH 3OH và C2H5OH thu được 4,48 lít khí CO2 (đktc) và m gam nước. a. Tính % khối lượng mỗi ancol trong hỗn hợp đầu. Tài liệu ôn tập Hóa Học 11 44
  37. b. Tính giá trị m. 0 c. Đun nóng hỗn hợp X với xúc tác H2SO4 đặc ở nhiệt độ 140 C thu được hỗn hợp 3 ete. Viết PTHH của các phản ứng xãy ra. Câu 15. Đốt cháy hoàn toàn 10,6 gam hỗn hợp X gồm hai ancol C 2H5OH và n-C3H7OH. Toàn bộ sản phẩm cháy thu được sục vào bình đựng dung dịch nước vôi trong dư thu được 50 gam kết tủa và khối lượng bình tăng lên m gam. a. Tính khối lượng mỗi ancol trong hỗn hợp ban đầu. b. Tính giá trị m. c. Cho hỗn hợp X qua ống đựng CuO đun nóng. Viết PTHH của các phản ứng xãy ra. Câu 16. Câu . Cho 11 gam hỗn hợp hai ancol no đơn chức, kế tiếp nhau trong dãy đồng đẳng tác dụng hết với Na dư thu được 3,36 lít H2 (đktc). a. Xác định công thức phân tử của hai ancol. b. Tính % khối lượng mỗi ancol trong hỗn hợp đầu. Câu 17. Đốt cháy hoàn toàn 0.1 mol một ancol no, đơn chức X cần V lít O 2 (đktc) thu được 6.72 lít khí CO2 (đktc) và gam nước. a. Xác định công thức phân tử của X. b. Tính giá trị m. c. Tính V bằng các phương pháp khác nhau. Câu 18. Đốt cháy hoàn toàn một ancol đơn chức X thu được 4,4 gam CO 2 và 3,6 gam H2O. Xác định công thức phân tử của X. Câu 19. Đun nóng 15,2 gam hỗn hợp 2 ancol no đơn chức, là đồng đẳng kế tiếp với H 2SO4 đặc ở 140OC, thu được 12,5 gam hỗn hợp 3 ete (h = 100%). a. Xác định công thức của 2 ancol. b. Tính % khối lượng mỗi ancol trong hỗn hợp đầu. Câu 20. Cho 3,7 gam một ancol no, đơn chức, mạch hở tác dụng với Na dư thấy có 0,56 lít khí thoát ra (ở đktc). Xác định công thức phân tử của X. Câu 21. Cho 14 gam hỗn hợp A gồm phenol và etanol tác dụng với Na dư thu được 2,24 lít khí H 2 (đktc). a. Viết PTHH của các phản ứng xãy ra. b. Tính % mỗi chất trong hỗn hợp A. c. Cho 14 gam hỗn hợp A tác dụng với dung dịch HNO3 (đủ) thì thu được bao nhiêu gam axit picric (2,4,6-trinitrophenol). Câu 22. Cho hỗn hợp A gồm etanol và phenol tác dụng với Na dư thu được 3,36 lít H 2 (đktc). Nếu cho hỗn hợp trên tác dụng với nước brom vừa đủ thu được 19,86 gam kết tủa trắng. a. Viết PTHH của các phản ứng xãy ra. b. Tính % theo khối lượng mỗi chất có trong hỗn hợp ban đầu. Câu 23. Cho natri tác dụng hoàn toàn với 18,8 gam hỗn hợp hai ancol no, đơn chức, mạch hở kế tiếp trong dãy đồng đẳng sinh ra 5,6 lít khí H2 (đktc). a. Xác định CTPT của hai ancol trên. b. Tính khối lượng mỗi ancol trong hỗn hợp ban đầu. Câu 24. Chia hỗn hợp X gồm hai ancol no, đơn chức, mạch hở thành hai phần bằng nhau. Đốt cháy hết phần (1) thu được 5,6 lít CO2 (đktc) và 6,3 g nước. Phần (2) tác dụng hết với natri thì thấy thoát ra V lít khí (đktc). Xác định V. Câu 25. Đốt cháy hết hỗn hợp gồm hai ancol no, đơn chức, mạch hở kế tiếp nhau trong dãy đồng đẳng thu được 5,6 lít CO2 (đktc) và 6,3 g nước. Xác định CTPT của hai ancol. Câu26. Cho 0,1 mol rượu X phản ứng hết với Na dư thu được 2,24 lít khí H 2(đktc). Số nhóm chức - OH của rượu X là bao nhiêu? Câu 27. Chia m gam hỗn hợp hai ancol thành hai phần bằng nhau. Tài liệu ôn tập Hóa Học 11 45
  38. Phần 1: Đốt cháy hoàn toàn, thu được 2,24 lít khí CO2 (đktc). Phần 2: Đehiđrat hóa hoàn toàn thu được hỗn hợp 2 anken. Nếu đốt cháy hết 2 anken thì thu được bao nhiêu gam nước? Câu 28. Oxi hoá 4,96 gam X là một ancol (rượu) đơn chức bậc 1 (h=100%), rối lấy anđehit thu được cho tác dụng hết với lượng dư AgNO 3 trong dung dịch NH 3, thu được 66,96 gam Ag. Xác định công thức của X . Câu 29. Oxi hoá hỗn hợp X gồm C 2H6O và C4H10O thu được hỗn hợp Y gồm 2 anđehit. Cho Y tác dụng với dung dịch AgNO 3 trong NH3 (dư) thu được m gam Ag. Cũng lượng X như trên, nếu cho tác dụng với Na dư thì thu được 1,12 lít khí H2(đktc). Tính giá trị của m. Câu 30. Đốt cháy hoàn toàn một ancol đơn chức X thu được 4,4 gam CO2 và 3,6 gam H2O. Nếu cho lượng X ở trên tách nước tạo ete (h=100%). Tính số gam ete thu được. Câu 31. Đun nóng 12,90 gam hỗn hợp X gồm 2 ancol no, đơn chức, bậc 1, là đồng đẳng kế tiếp o trong H2SO4 đặc ở 140 C thu được 10,65 gam hỗn hợp Y gồm 3 ete (h = 100%). Xác định công thức phân tử của hai ancol. Câu 32. Đốt cháy hoàn toàn m gam hỗn hợp hai ancol đơn chức A và B thuộc cùng một dãy đồng đẳng, người ta thu được 70,4 gam CO2 và 39,6 gam H2O. Tính giá trị của m. Câu 33. Chia 27,6 gam hỗn hợp 3 ancol đơn chức thành 2 phần bằng nhau. Phần 1 cho tác dụng hết với Na, thu được 3,36 lít khí H2 (đktc). Phần 2 tách nước thu được m gam hỗn hợp 6 ete (h=100%). Tính giá trị của m. Câu 34 (B-2010). Đốt cháy hoàn toàn một lượng hỗn hợp X gồm 2 ancol (đều no, hai chức, mạch hở) cần vừa đủ V lít khí O2, thu được 11,2 lít khí CO2 và 12,6 gam H2O (các thể tích khí đo ở đktc). Tính Giá trị của V. D. PHẦN BÀI TẬP NÂNG CAO Câu 1 (B-2010). Đốt cháy hoàn toàn một lượng hỗn hợp X gồm 2 ancol (đều no, đa chức, mạch hở, có cùng số nhóm -OH) cần vừa đủ V lít khí O2, thu được 11,2 lít khí CO2 va 12,6 gam H2O (các thể tích khí đo ở đktc). Tính giá trị của V. Câu 2 (CĐ-08). Đốt cháy hoàn toàn một rượu (ancol) đa chức, mạch hở X, thu được H 2O và CO2 với tỉ lệ số mol tương ứng là 3:2. Xác định công thức phân tử của X. Câu 3 (B-2007). X là ancol (rượu) no, mạch hở. Đốt cháy hoàn toàn 0,05 mol X cần 5,6 gam oxi, thu được hơi nước và 6,6 gam CO2. Xác định công thức của X. Câu 4 (B-2010). Đốt cháy hoàn toàn m gam hỗn hợp X gồm ba ancol (đơn chức, thuộc cùng dãy đồng đẳng), thu được 8,96 lít khí CO 2 (đktc) và 11,7 gam H2O. Mặt khác, nếu đun nóng m gam X với H2SO4 đặc thì thu được x gam hỗn hợp các ete. Tính giá trị của x. Câu 5 (B-08). Đun nóng một rượu (ancol) đơn chức X với dung dịch H 2SO4 đặc trong điều kiện nhiệt độ thích hợp sinh ra chất hữu cơ Y, tỉ khối hơi của X so với Y là 1,6428. Xác định công thức phân tử của X. Câu 6 (A-2010). Oxi hoá hết 2,2 gam hỗn hợp hai ancol đơn chức thành anđehit cần vừa đủ 4,8 gam CuO. Cho toàn bộ lượng anđehit trên tác dụng với lượng dư dung dịch AgNO3 trong NH3, thu được 23,76 gam Ag. Xác định công thức phân tử của hai ancol. Câu 7 (CĐA-08). Oxi hoá ancol đơn chức X bằng CuO (đun nóng), sinh ra một sản phẩm hữu cơ duy nhất là xeton Y (tỉ khối hơi của Y so với khí hiđro bằng 29). Xác định công thức cấu tạo của X. Câu 8 (B-07). Cho m gam một ancol (rượu) no, đơn chức qua bình đựng CuO (dư), nung nóng. Sau khi phản ứng hoàn toàn, khối lượng chất rắn trong bình giảm 0,32 gam. Hỗn hợp hơi thu được có tỉ khối so với hiđro là 15,5. Tính giá trị của m. Câu 9. Đốt cháy hoàn toàn một ancol đơn chức X thu được 4,4 gam CO 2 và 3,6 gam H2O. Nếu cho Tài liệu ôn tập Hóa Học 11 46
  39. lượng X ở trên tách nước tạo ete (h=100%) thì số gam ete thu được là bao nhiêu? Câu 10. Cho 15,6 gam hỗn hợp X gồm 2 ancol (rượu) đơn chức, kế tiếp nhau trong dãy đồng đẳng tác dụng hết với 9,2 gam Na, thu được 24,5 gam chất rắn. Nếu cho 15,6 gam X tách nước tạo ete (h = 100%) thì số gam ete thu được là bao nhiêu? Câu 11 (A-2010). Đốt cháy hoàn toàn m gam hỗn hợp 3 ancol đơn chức, thuộc cùng dãy đồng đẳng, thu được 3,808 lít khí CO2 (đktc) và 5,4 gam H2O. Tính giá trị của m. Câu 12 (CĐ-2010). Cho 10 ml dung dịch ancol etylic 46 0 phản ứng hết với kim lại Na (dư), thu được V lít khí H2 (đktc). Biết khối lượng riêng của ancol etylic nguyên chất bằng 0,8 g/ml. Tính giá trị của V. CHUYÊN ĐỀ IV: ANDEHIT - XETON - AXIT CACBOXYLIC A. PHẦN LÝ THUYẾT I. ANDEHIT 1. Định nghĩa - Danh pháp a. Định nghĩa: Andehit là những hợp chất hữu cơ mà phân tử có nhóm -CH=O liên kết trực tiếp với nguyên tử C hoặc nguyên tử H. - Ví dụ: HCHO, CH3CHO b. Danh pháp: - Tên thay thế của các andehit no đơn chức mạch hở như sau: Tên hidrocacbon no tương ứng với mạch chính + al 4 3 2 1 Ví dụ: CH3 CH(CH3 )CH2 CHO (3-metylbutanal) - Tên thường của một số anđehit: Andehit + tên axit tương ứng Ví dụ: HCHO (andehit fomic), CH3CHO (andehit axetic) . . . 2. Tính chất hóa học - Vừa thể hiện tính oxi hóa, vừa thể hiện tính khử a. Tính oxi hóa: Phản ứng cộng H2 (tạo thành ancol bậc I): Ni, t0 RCHO + H2  RCH2OH b. Tính khử: Tác dụng với các chất oxi hóa t0 R-CHO + 2AgNO3 + H2O + 3NH3  R-COONH4 + 2Ag↓ + 2NH4NO3 t0 R-CHO + 2Cu(OH)2 + NaOH  RCOONa + Cu2O↓ + 3H2O (đỏ gạch) Các phản ứng trên dùng để nhận biết andehit. 3. Điều chế - Để điều chế andehit ta đi từ ancol bằng phản ứng oxi hóa không hoàn toàn. t0 CH3CH2OH + CuO  CH3CHO + Cu + H2O - Đi từ hidrocacbon. xt, t0 2CH2=CH2 + O2  2CH3CHO II. XETON 1. Định nghĩa - Là những hợp chất hữu cơ mà phân tử có nhóm C=O liên kết trực tiếp với hai nguyên tử C. -Ví dụ: CH3-CO-CH3 (đimetyl xeton), CH3-CO-C6H5 (metyl phenyl xeton) . . . 2. Tính chất hóa học - Cộng H2 tạo thành ancol bậc II. Ni, t0 R-CO-R’ + H2  RCH(OH)R’ Ni, t0 CH3-CO-CH3 + H2  CH3CH(OH)CH3 Tài liệu ôn tập Hóa Học 11 47
  40. - Xeton không tham gia phản ứng tráng gương. 3. Điều chế - Oxi hóa không hoàn toàn ancol bậc II. t0 CH3CH(OH)CH3 + CuO  CH3-CO-CH3 + Cu + H2O - Đi từ hidrocacbon. III. AXIT CACBOXYLIC 1. Định nghĩa - Danh pháp a. Định nghĩa - Là những phân tử hợp chất hữu cơ mà phân tử có nhóm -COOH liên kết trực tiếp với nguyên tử C hoặc nguyên tử H. - Ví dụ: HCOOH, CH3COOH, . . . b. Danh pháp - Tên thay thế của các axit cacboxylic no, đơn chức, mạch hở như sau: Axit + tên hidrocacbon no tương ứng với mạch chính + oic 5 4 3 2 1 - Ví dụ: CH3 CH(CH3 )CH2 CH2 COOH (Axit-4-metylpentanoic) 2. Tính chất vật lý - Axit tan nhiều trong nước do tạo được liên kết H với nước và độ tan giảm dần khi số nguyên tử C tăng lên. - Nhiệt độ sôi cao hơn ancol tương ứng do liên kết H giữa các nguyên tử bền hơn liên kết H giữa các phân tử ancol. 3. Tính chất hóa học a. Tính axit: Có đầy đủ tính chất của một axit. CH3COOH + NaOH → CH3COONa + H2O 2CH3COOH + ZnO → (CH3COO)2Zn + H2O 2CH3COOH + CaCO3 → (CH3COO)2Ca + CO2↑ + H2O 2CH3COOH + Zn → (CH3COO)2Zn + H2↑ b. Phản ứng thế nhóm -OH (phản ứng este hóa): H+ , t0 RCOOH + R’OH  RCOOR’ + H2O H+ , t0 CH3COOH + C2H5OH  CH3COOC2H5 + H2O etyl axetat 4. Điều chế axit axetic a. Lên men giấm men giÊm C2H5OH + O2  CH3COOH + H2O b. Oxi hóa andehit axetic xt 2CH3CHO + O2  2CH3COOH c. Oxi hóa ankan d. Từ metanol t0 , xt CH3OH + CO  CH3COOH Đây là phương pháp hiện đại sản xuất axit axetic. B. BÀI TẬP CÓ HƯỚNG DẪN GIẢI Ví dụ 1: Câu 1 (CĐ-08). Cho hỗn hợp gồm 0,1 mol HCHO và 0,1 mol HCOOH tác dụng với lượng dư Ag2O (hoặc AgNO3) trong dung dịch NH3, đun nóng. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng Ag tạo thành là bao nhiêu? Giải HCHO 4Ag Tài liệu ôn tập Hóa Học 11 48
  41. 0.1 0.4 HCOOH 2Ag 0.1 0.2 mAg = 0.6*108 = 64.8 (gam) Ví dụ 2: Trung hòa hoàn toàn 10,6 gam hỗn hợp X gồm axit axetic và axit fomic cần 200 ml dung dịch NaOH 1M. Tính khối lượng mỗi axit trong hỗn hợp ban đầu. Giải nNaOH = 0.2*1 = 0.2 (mol) Đặt n = x; n = y HCOOH CH3COOH HCOOH + NaOH HCOONa + H2O x x CH3COOH + NaOH CH3COONa + H2O y y x + y = 0.2 x = 0.1 mHCOOH = 46*0.1 = 4.6 (gam) Ta có hệ PT: 46x + 60y = 10.6 y = 0.1 m = 60*0.1 = 6 (gam) CH3COOH C. PHẦN BÀI TẬP CƠ BẢN Câu 1. Viết CTCT của các andehit có CTPT là C4H8O và gọi tên chúng theo tên thay thế. Câu 2. Gọi tên các andehit sau theo danh pháp thường: HCHO, CH3CHO, CH3CH2CHO, CH2=CHCHO. Câu 3. Gọi tên các andehit sau theo danh pháp thay thế: HCHO, CH3CHO, CH3CH2CHO, CH3CH(CH3)-CH2-CHO, CH3-CH(CH3)-CH(CH3)-CHO. Câu 4. Viết CTCT các andehit có tên gọi sau: a. Andehit acrylic, andehit propionic, andehit axetic, 2-metylbutanal. b. 2,2-đimetylbutanal, andehit fomic, 3,4-đimetylpentanal, andehit oxalic. Câu 5. Hoàn thành các PTHH của các phản ứng sau: a. CH3CHO + AgNO3 + NH3 b. RCHO + AgNO3 + NH3 Ni, t0 c. CH3CHO + H2  Ni, t0 d. RCHO + H2  Hg2 e. CH≡CH + H2O  xt f. CH2=CH2 + O2  Câu 5. Viết PTHH điều chế các chất sau từ các chất hữu cơ tương ứng: Ancol etylic, ancol iso-propylic, ancol n-propylic, andehit axetic, andehit fomic. Câu 6. Viết CTCT, gọi tên các axit (theo danh pháp thay thế) có CTPT C4H8O2. Câu 7. Gọi tên các axit sau theo danh pháp thường: HCOOH, CH3COOH, CH3CH2COOH, CH2=CHCOOH, CH2=C(CH3) COOH, HOOC-COOH. Câu 8. Viết CTCT các andehit có tên gọi sau: a. Axit acrylic, axit propionic, axit axetic, axit -2-metylbutanoic. b. Axit - 2,2-đimetylbutanoic, axit fomic, axit - 3,4-đimetylpentanoic, axit oxalic. Câu 9. Hoàn thành các PTHH của các phản ứng sau: a. CH3COOH + Na b. HCOOH + KOH 0 H3SO4 (®Æc), t C c. CH3COOH + C2H5OH  0 H3SO4 (®Æc), t C d. RCOOH + R’OH  Tài liệu ôn tập Hóa Học 11 49
  42. men giÊm e. C2H5OH + O2  Câu 10. Viết PTHH điều chế các chất sau từ các chất hữu cơ tương ứng: Etyl axetat, axit axetic, axit fomic. Câu 11. Hoàn thành chuổi phản ứng sau: a. Metan (1) metyl clorua (2) metanol (3) metanal (4) axit fomic. b. Etanol (1) andehit axetic (2) axit axetic (3) etyl axetat. c. Propen (1) propan-2-ol (2) axeton. d. Etilen (1) andehit axetic (2) axit axetic (3) etyl axetat. Câu 12. Nhận biết các chất sau bằng phương pháp hóa học: a. Andehit axetic, axit axetic, glixerol và etanol. b. Axit fomic, andehit axetic, axit axetic, ancol etylic c. Propan-1-ol, propan-1,2-điol, andehit axetic, axit axetic. Câu 13. Từ metan và các hóa chất vô cơ cần thiết khác có thể điều chế được axit fomic và axit axetic. Viết PTHH của các phản ứng xãy ra. Câu 14. Trung hòa 16,6 gam hỗn hợp axit axetic và axit fomic bằng dung dịch natri hiđroxit thu được 23,2 gam hỗn hợp hai muối. Xác định thành phần % khối lượng mỗi axit trong hỗn hợp đầu. Câu 15 (CĐA-09). Cho 0,1 mol hỗn hợp X gồm hai anđehit no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng tác dụng với lượng dư dung dịch AgNO 3 trong NH3, đun nóng thu được 32,4 gam Ag. Xác định CTPT của anđehit trong X. Câu 16. Cho 0,94 g hỗn hợp hai anđehit đơn chức, no, kế tiếp nhau trong dãy đồng đẵng tác dụng với dung dịch AgNO3 trong NH3 thu được 3,24 gam Ag. a. Xác định CTPT của hai anđehit. b. Tính % theo khối lượng mỗi andehit trong hỗn hợp đầu. Câu 17. Đốt cháy hoàn toàn 4,4 gam một andehit X thu được 4,48 lít khí CO 2 (đktc) và 3,6 gam nước. Xác định CTPT của X. 0 Câu 18. Cho hỗn hợp X gồm 2 anđehit đồng đẳng kế tiếp tác dụng hết với H 2 (Ni, t ), thu được hỗn hợp Y. Đốt cháy hoàn toàn Y thu được 6,6 gam CO2 và 4,5 gam H2O. a. Xác định công thức phân tử của 2 anđehit trong X. b. Tính khối lượng của mỗi andehit trong hỗn hợp X. Câu 19. Trung hòa hoàn toàn 10,6 gam hỗn hợp X gồm axit axetic và axit fomic cần 200 ml dung dịch NaOH 1M. a. Tính khối lượng mỗi axit trong hỗn hợp ban đầu. b. Tính khối lượng muối thu được. Câu 20. Để trung hoà 8,8 gam một axit cacboxylic mạch không nhánh thuộc dãy đồng đẳng của axit fomic cần 100ml dung dịch NaOH 1M. Xác định công thức cấu tạo và tên gọi của axit đó. Câu 21. Đốt cháy hoàn toàn 0,1 mol hỗn hợp 2 axit cacboxylic là đồng đẳng kế tiếp thu được 3,36 lít CO2 (đktc) và 2,7 gam H2O. a. Xác định công thức phân tử của mỗi axit. b. Tính % theo khối lượng mỗi axit trong hỗn hợp đầu. Câu 22 (CĐA-08). Đun nóng 6,0 gam CH 3COOH với 6,0 gam C 2H5OH (có H2SO4 làm xúc tác, hiệu suất phản ứng este hoá bằng 50%). Tính khối lượng este tạo thành. Câu 23. Hỗn hợp A gồm X, Y là 2 axit no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng. Cho 10,6 gam hỗn hợp A tác dụng hết với Na thu được 2,24 lít khí H2 (đktc). a. Xác định công thức phân tử của X và Y. b. Tính khối lượng mỗi axit trong hỗn hợp A. Tài liệu ôn tập Hóa Học 11 50
  43. Câu 24. Đốt cháy hoàn toàn 6 gam một axit X thu được 4,48 lít khí CO2 (đktc) và 3,6 gam H2O. Xác định công thức phân tử của X. Câu 25. Đốt cháy hoàn toàn 0,88 gam 2 axit là đồng phân của nhau thu được 1,76 gam CO2 và 0,72 gam H2O. a. Xác định công thức phân tử của 2 axit. b. Viết CTCT của 2 axit đó. Câu 26. Đốt cháy hoàn toàn 8,8 gam một axit no, đơn chức X cần 11,2 lít khí O 2 (đktc). Xác định công thức phân tử của axit. Câu 27. Cho 90 gam axit axetic tác dụng với 69 gam rượu etylic (H2SO4 xúc tác). Khi phản ứng đạt tới cân bằng thì 66% lượng axit đã chuyển thành ete, khối lượng este sinh ra là bao nhiêu gam? Câu 28. Trung hòa hoàn toàn 3 gam một axit cacboxilic no đơn chức X cần dùng vừa đủ 100ml dung dịch NaOH 0,5M. Tên gọi của X là gì? Câu 29. Cho 1,74gam một anđehit no, đơn chức phản ứng hoàn toàn với AgNO 3/NH3 sinh ra 6,48 gam bạc kim loại. Xác định công thức cấu tạo của anđehit. Câu 30. Cho 0,92 gam hỗn hợp gồm axetilen và anđehit axetic phản ứng hoàn toàn với dung dịch AgNO3 trong NH3 thu được 5,64gam hỗn hợp rắn. Xác định thành phần % các chất trong hỗn hợp đầu. Câu 31. Cho 10,9 g hỗn hợp gồm axit acrylic và axit propionic phản ứng hoàn toàn với Na thoát ra 1,68 lít khí (đktc). Nếu cho hỗn hợp trên tham gia phản ứng cộng H 2 hoàn toàn thì khối lượng sản phẩm cuối cùng là bao nhiêu? Câu 32. Hỗn hợp X có khối lượng 10g gồm axit axetic và anđehit axetic. Cho X tác dụng với lượng dư dd AgNO3 trong amoniac thấy có 21,6g Ag kết tủa. Để trung hòa X cần Vml dd NaOH 0,2M. Giá trị của V bằng bao nhiêu? D. PHẦN BÀI TẬP NÂNG CAO Câu 1 (CĐ-08). Cho hỗn hợp gồm 0,1 mol HCHO và 0,1 mol HCOOH tác dụng với lượng dư Ag2O (hoặc AgNO3) trong dung dịch NH3, đun nóng. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng Ag tạo thành là bao nhiêu? Câu 2 (A-08). Cho 3,6 gam anđehit đơn chức X phản ứng hoàn toàn với một lượng dư Ag 2O (hoặc AgNO3) trong dung dịch NH3 đun nóng, thu được m gam Ag. Hoà tan hoàn toàn m gam Ag bằng dung dịch HNO3 đặc, sinh ra 2,24 lít NO2 (sản phẩm khử duy nhất, ở đktc). Xác định công thức của X. Câu 3 (B-07). Khi oxi hoá 2,2 gam một anđehit đơn chức thu được 3 gam axit tương ứng. Xác định công thức của anđehit. Câu 4 (B-08). Cho 3,6 gam axit cacboxylic no, đơn chức X tác dụng hoàn toàn với 500 ml dung dịch gồm KOH 0,12M và NaOH 0,12M. Cô cạn dung dịch thu được 8,28 gam hỗn hợp chất rắn khan. Xác định công thức phân tử của X. Câu 5 (CĐ-2010). Cho 45 gam axit axetic phản ứng với 69 gam ancol etylic (xúc tác H 2SO4 đặc), đun nóng, thu được 41,25 gam etyl axetat. Tính hiệu suất của phản ứng este hoá. Câu 6 (CĐ-08). Đun nóng 6,0 gam CH 3COOH với 6,0 gam C2H5OH (có H2SO4 làm xúc tác, hiệu suất phản ứng este hoá bằng 50%). Tính khối lượng este tạo thành. Câu 7 (A-2010). Cho m gam hỗn hợp etanal và propanal phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, thu được 43,2 gam kết tủa và dung dịch chứa 17,5 gam muối amoni của hai axit hữu cơ. Tính giá trị của m. Câu 8 (CĐ-09). Hiđro hoá hoàn toàn hỗn hợp M gồm hai anđehit X và Y no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng (MX < MY), thu được hỗn hợp hai ancol có khối lượng lớn hơn khối lượng M là 1 gam. Đốt cháy hoàn toàn M thu được 30,8 gam CO 2. Xác định công thức và phần trăm khối lượng của X trong hỗn hợp M. Tài liệu ôn tập Hóa Học 11 51
  44. Câu 9 (A-08). Cho 3,6 gam anđehit đơn chức X phản ứng hoàn toàn với một lượng dư Ag 2O (hoặc AgNO3) trong dung dịch NH3 đun nóng, thu được m gam Ag. Hoà tan hoàn toàn m gam Ag bằng dung dịch HNO3 đặc, sinh ra 2,24 lít NO2 (sản phẩm khử duy nhất, ở đktc). Xác định công thức của X. Câu 10 (A-08). Trung hoà 5,48 gam hỗn hợp gồm axit axetic, phenol và axit benzoic, cần dùng 600 ml dung dịch NaOH 0,1M. Cô cạn dung dịch sau phản ứng, thu được m gam hỗn hợp chất rắn khan. Tính giá trị m. Câu 11 (B-07). Để trung hoà 6,72 gam một axit cacboxylic Y (no, đơn chức), cần dùng 200 gam dung dịch NaOH 2,24%. Xác định công thức của Y. Câu 12 (B-07). Đốt cháy hoàn toàn 0,1 mol một axit cacboxylic đơn chức, cần vừa đủ V lít O 2 (đktc), thu được 0,3 mol CO2 và 0,2 mol H2O. Tính giá trị của V. Tài liệu ôn tập Hóa Học 11 52